<- User:Beetstra/listing9 - User:Beetstra/Validation - User:Beetstra/listing11 ->

Data

2251 to 2300

Buphenine (2251)
```
Botcommand: addindex 345616313 Buphenine
```
```
For index : Buphenine=345616313
```
* 447-41-6 -> 447-41-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Buphenine not found on commonchemistry - Buphenine

* ChemSpiderID: 4407 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 4567

* No InChI - (ChemSpider: | InChI=InChI=1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C )
Bupivacaine (2252)
```
Botcommand: addindex 360229778 Bupivacaine
```
```
For index : Bupivacaine=360229778
```
* 18010-40-7 -> 18010-40-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Bupivacaine found on commonchemistry - Bupivacaine
* 38396-39-3 (Formula: C18H28N2O; Name: 2-Piperidinecarboxamide, 1-butyl-N-(2,6-dimethylphenyl)-)

* 2180-92-9 (Formula: ; Name: 2-Piperidinecarboxamide, 1-butyl-N-(2,6-dimethylphenyl)-)

* 27262-47-1 (Formula: C18H28N2O; Name: 2-Piperidinecarboxamide, 1-butyl-N-(2,6-dimethylphenyl)-, (2S)-)

* ChemSpiderID: 4445574 (correct: 4445574) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5282419

* No InChI - (ChemSpider: | InChI=InChI=1/C18H28N2O.ClH.H2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;;/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);1H;1H2 )

* No SMILES - (ChemSpider: | smiles=Cl.O=C(Nc1c(cccc1C)C)C2N(CCCC)CCCC2.O )
Bupranolol (2253)
```
Botcommand: addindex 360224881 Bupranolol
```
```
For index : Bupranolol=360224881
```
* 23284-25-5 -> 23284-25-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Bupranolol not found on commonchemistry - Bupranolol

* No ChemSpiderID

* PubChem: 2475

* No InChI

* No SMILES
Bupropion (2255)
```
Botcommand: addindex 365056556 Bupropion
```
```
For index : Bupropion=365056556
```
* 34841-39-9 -> 34841-39-9 - NOT VERIFIED

* CAS found on commonchemistry - 34841-39-9 - name not in list
All names: [[1-Propanone, 1-(3-chlorophenyl)-2-[(1,1-dimethylethyl)amino]-]]

* Bupropion not found on commonchemistry - Bupropion

* ChemSpiderID: 431 (correct: 431) - CORRECT - Retrieved data from ChemSpider

* PubChem: 444

* No InChI - (ChemSpider: | InChI=InChI=1/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3 )

* No SMILES - (ChemSpider: | smiles=O=C(c1cc(Cl)ccc1)C(NC(C)(C)C)C )
Burgess_reagent (2256)
```
Botcommand: addindex 337364006 Burgess_reagent
```
```
For index : Burgess_reagent=337364006
```
* 29684-56-8 -> 29684-56-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Burgess+reagent not found on commonchemistry - Burgess+reagent

* ChemSpiderID: 2007108 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2724994

* InChI: 1/C8H18N2O4S/c1-5-10(6-2,7-3)15(12,13)9-8(11)14-4/h5-7H2,1-4H3 - (ChemSpider: | InChI=InChI=1/C8H18N2O4S/c1-5-10(6-2,7-3)15(12,13)9-8(11)14-4/h5-7H2,1-4H3 )

* SMILES: O=S(=O)(N=C([O-])OC)[N+](CC)(CC)CC - (ChemSpider: | SMILES=O=S(=O)(N=C([O-])OC)[N+](CC)(CC)CC )
Burimamide (2257)
```
Botcommand: addindex 337364079 Burimamide
```
```
For index : Burimamide=337364079
```
* 34970-69-9 -> 34970-69-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Burimamide not found on commonchemistry - Burimamide

* ChemSpiderID: 2297780 (correct: 2297780) - CORRECT - Retrieved data from ChemSpider

* PubChem: 3032915

* InChI: 1/C9H16N4S/c1-10-9(14)12-5-3-2-4-8-6-11-7-13-8/h6-7H,2-5H2,1H3,(H,11,13)(H2,10,12,14) - (ChemSpider: | InChI=InChI=1/C9H16N4S/c1-10-9(14)12-5-3-2-4-8-6-11-7-13-8/h6-7H,2-5H2,1H3,(H,11,13)(H2,10,12,14) )

* SMILES: S=C(NC)NCCCCc1cncn1 - (ChemSpider: | SMILES=S=C(NC)NCCCCc1cncn1 )
Buscaline (2258)
```
Botcommand: addindex 353734414 Buscaline
```
```
For index : Buscaline=353734414
```
* 64778-75-2 -> 64778-75-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Buscaline not found on commonchemistry - Buscaline

* ChemSpiderID: 10440102 (correct: 10440102) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C14H23NO3/c1-4-5-8-18-14-12(16-2)9-11(6-7-15)10-13(14)17-3/h9-10H,4-8,15H2,1-3H3 - (ChemSpider: | InChI=InChI=1/C14H23NO3/c1-4-5-8-18-14-12(16-2)9-11(6-7-15)10-13(14)17-3/h9-10H,4-8,15H2,1-3H3 )

* SMILES: COc1cc(cc(OC)c1OCCCC)CCN - (ChemSpider: | SMILES=COc1cc(cc(OC)c1OCCCC)CCN )
Buserelin (2259)
```
Botcommand: addindex 352955839 Buserelin
```
```
For index : Buserelin=352955839
```
* 57982-77-1 -> 57982-77-1 - NOT VERIFIED

* CAS found on commonchemistry - 57982-77-1 - name in list
All names: [[[D-Ser(tert-butyl)6,des-Gly-NH210]-LH-RH ethylamide]], [[[D-Ser6(t-Bu),de-Gly10-NH2]-LH-RH ethylamide]], 1-9-(D-Ser(t-butyl))6-LH-releasing hormone ethylamide, [[1-9-Luteinizing hormone-releasing factor (swine), 6-[O-(1,1-dimethylethyl)-D-serine]-9-(N-ethyl-L-prolinamide)-]], buserelin, buserelina, busereline, Etilamide, HOE 766, HOE 766A, ICI 123215, [[Luteinizing hormone-releasing factor (pig), 6-[O-(1,1-dimethylethyl)-D-serine]-9-(N-ethyl-L-prolinamide)-10-deglycinamide-]], Receptal, Suprefact

* Buserelin found on commonchemistry - Buserelin
* 57982-77-1 (exact match) Matches CAS (57982-77-1) on page
Name in list

All names: [[[D-Ser(tert-butyl)6,des-Gly-NH210]-LH-RH ethylamide]], [[[D-Ser6(t-Bu),de-Gly10-NH2]-LH-RH ethylamide]], 1-9-(D-Ser(t-butyl))6-LH-releasing hormone ethylamide, [[1-9-Luteinizing hormone-releasing factor (swine), 6-[O-(1,1-dimethylethyl)-D-serine]-9-(N-ethyl-L-prolinamide)-]], [[buserelin]], [[buserelina]], [[busereline]], Etilamide, HOE 766, HOE 766A, ICI 123215, [[Luteinizing hormone-releasing factor (pig), 6-[O-(1,1-dimethylethyl)-D-serine]-9-(N-ethyl-L-prolinamide)-10-deglycinamide-]], Receptal, Suprefact

* ChemSpiderID: 45545 (correct: 45545) - CORRECT - Retrieved data from ChemSpider

* PubChem: 50225

* No InChI - (ChemSpider: | InChI=InChI=1/C60H86N16O13/c1-7-64-57(87)48-15-11-23-76(48)58(88)41(14-10-22-65-59(61)62)69-51(81)42(24-33(2)3)70-56(86)47(31-89-60(4,5)6)75-52(82)43(25-34-16-18-37(78)19-17-34)71-55(85)46(30-77)74-53(83)44(26-35-28-66-39-13-9-8-12-38(35)39)72-54(84)45(27-36-29-63-32-67-36)73-50(80)40-20-21-49(79)68-40/h8-9,12-13,16-19,28-29,32-33,40-48,66,77-78H,7,10-11,14-15,20-27,30-31H2,1-6H3,(H,63,67)(H,64,87)(H,68,79)(H,69,81)(H,70,86)(H,71,85)(H,72,84)(H,73,80)(H,74,83)(H,75,82)(H4,61,62,65)/t40-,41-,42-,43-,44-,45-,46-,47+,48-/m0/s1 )

* No SMILES
Butabarbital (2262)
```
Botcommand: addindex 349298096 Butabarbital
```
```
For index : Butabarbital=349298096
```
* 143-81-7 -> 143-81-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Butabarbital found on commonchemistry - Butabarbital
* 125-40-6 (exact match)
Name in list

All names: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylpropyl)-, 5-sec-Butyl-5-ethylbarbituric acid, Barbituric acid, 5-sec-butyl-5-ethyl-, Butabarb, [[butabarbital]], Butabarbitone, Butatab, Butatal, Medarsed, Nilox, NSC 27517, Secbubarbital, [[secbutabarbital]], [[sec-butabarbital]], Secbutobarbitone, sec-Butobarbitone, Unicelles

* ChemSpiderID: 2385 (correct: 2385) - CORRECT - Retrieved data from ChemSpider

* PubChem: 2479

* No InChI - (ChemSpider: | InChI=InChI=1/C10H16N2O3/c1-4-6(3)10(5-2)7(13)11-9(15)12-8(10)14/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15) )

* No SMILES - (ChemSpider: | smiles=O=C1NC(=O)NC(=O)C1(C(C)CC)CC )
Butacaine (2263)
```
Botcommand: addindex 337365941 Butacaine
```
```
For index : Butacaine=337365941
```
* 149-16-6 -> 149-16-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Butacaine not found on commonchemistry - Butacaine

* ChemSpiderID: 2386 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2480

* InChI: 1/C18H30N2O2/c1-3-5-12-20(13-6-4-2)14-7-15-22-18(21)16-8-10-17(19)11-9-16/h8-11H,3-7,12-15,19H2,1-2H3 - (ChemSpider: | InChI=InChI=1/C18H30N2O2/c1-3-5-12-20(13-6-4-2)14-7-15-22-18(21)16-8-10-17(19)11-9-16/h8-11H,3-7,12-15,19H2,1-2H3 )

* SMILES: O=C(OCCCN(CCCC)CCCC)c1ccc(N)cc1 - (ChemSpider: | SMILES=O=C(OCCCN(CCCC)CCCC)c1ccc(N)cc1 )
Butaclamol (2264)
```
Botcommand: addindex 360220857 Butaclamol
```
```
For index : Butaclamol=360220857
```
* 36504-93-5 -> 36504-93-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Butaclamol not found on commonchemistry - Butaclamol

* ChemSpiderID: 34364 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 37459

* No InChI - (ChemSpider: | InChI=InChI=1/C25H31NO/c1-24(2,3)25(27)13-14-26-16-21-19-9-5-4-7-17(19)11-12-18-8-6-10-20(23(18)21)22(26)15-25/h4-10,21-22,27H,11-16H2,1-3H3/t21-,22-,25-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O[C@]5(CCN4[C@H](c1c3c(ccc1)CCc2ccccc2[C@@H]3C4)C5)C(C)(C)C )
Butalamine (2265)
```
Botcommand: addindex 337365980 Butalamine
```
```
For index : Butalamine=337365980
```
* 22131-35-7 -> 22131-35-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Butalamine not found on commonchemistry - Butalamine

* ChemSpiderID: 28712 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 30949

* No InChI - (ChemSpider: | InChI=InChI=1/C18H28N4O/c1-3-5-13-22(14-6-4-2)15-12-19-18-20-17(21-23-18)16-10-8-7-9-11-16/h7-11H,3-6,12-15H2,1-2H3,(H,19,20,21) )

* No SMILES - (ChemSpider: | smiles=n1c(onc1c2ccccc2)NCCN(CCCC)CCCC )
Butallylonal (2267)
```
Botcommand: addindex 337366031 Butallylonal
```
```
For index : Butallylonal=337366031
```
* 1142-70-7 -> 1142-70-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Butallylonal not found on commonchemistry - Butallylonal

* ChemSpiderID: 13723 (correct: 13723) - CORRECT - Retrieved data from ChemSpider

* PubChem: 14362

* No InChI - (ChemSpider: | InChI=InChI=1/C11H15BrN2O3/c1-4-6(2)11(5-7(3)12)8(15)13-10(17)14-9(11)16/h6H,3-5H2,1-2H3,(H2,13,14,15,16,17) )

* No SMILES - (ChemSpider: | smiles=O=C1NC(=O)NC(=O)C1(C(C)CC)CC(\Br)=C )
Butamirate (2268)
```
Botcommand: addindex 349556540 Butamirate
```
```
For index : Butamirate=349556540
```
* 18109-80-3 -> 18109-80-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Butamirate not found on commonchemistry - Butamirate

* ChemSpiderID: 26873 (correct: 26873) - CORRECT - Retrieved data from ChemSpider

* PubChem: 28892

* No InChI - (ChemSpider: | InChI=InChI=1/C18H29NO3/c1-4-17(16-10-8-7-9-11-16)18(20)22-15-14-21-13-12-19(5-2)6-3/h7-11,17H,4-6,12-15H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=O=C(OCCOCCN(CC)CC)C(c1ccccc1)CC )
Butanilicaine (2271)

* No CASNo

* Butanilicaine not found on commonchemistry - Butanilicaine

* No ChemSpiderID

* PubChem: 22379

* No InChI

* SMILES: CCCCNCC(=O)NC1=C(C=CC=C1Cl)C
Butaperazine (2273)
```
Botcommand: addindex 346030651 Butaperazine
```
```
For index : Butaperazine=346030651
```
* 653-03-2 -> 653-03-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Butaperazine not found on commonchemistry - Butaperazine

* ChemSpiderID: 12078 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 12598

* No InChI - (ChemSpider: | InChI=InChI=1/C24H31N3OS/c1-3-7-22(28)19-10-11-24-21(18-19)27(20-8-4-5-9-23(20)29-24)13-6-12-26-16-14-25(2)15-17-26/h4-5,8-11,18H,3,6-7,12-17H2,1-2H3 )

* No SMILES - (ChemSpider: | smiles=O=C(c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(C)CC4)CCC )
Butaxamine (2274)
```
Botcommand: addindex 357951481 Butaxamine
```
```
For index : Butaxamine=357951481
```
* 2922-20-5 -> 2922-20-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Butaxamine not found on commonchemistry - Butaxamine

* No ChemSpiderID (correct: 20593)

* PubChem: 18026

* No InChI

* No SMILES
Butein (2275)
```
Botcommand: addindex 362763690 Butein
```
```
For index : Butein=362763690
```
* 487-52-5 -> 487-52-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Butein not found on commonchemistry - Butein

* No ChemSpiderID

* PubChem: 5281222

* No InChI

* SMILES: C1=CC(=C(C=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O)O
Buthionine_sulfoximine (2277)
```
Botcommand: addindex 282624162 Buthionine_sulfoximine
```
```
For index : Buthionine_sulfoximine=282624162
```
* 5072-26-4 -> 5072-26-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Buthionine+sulfoximine not found on commonchemistry - Buthionine+sulfoximine

* No ChemSpiderID

* PubChem: 21157

* No InChI

* SMILES: CCCCS(=N)(=O)CCC(C(=O)O)N
Butin_(molecule) (2278)
```
Botcommand: addindex 347187813 Butin_(molecule)
```
```
For index : Butin_(molecule)=347187813
```
* 492-14-8 -> 492-14-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Butin+molecule not found on commonchemistry - Butin+molecule

* No ChemSpiderID

* PubChem: 92775

* No InChI

* SMILES: C1C(OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)OC1[C@H](OC2=C(C1=O)C=CC(=C2)O)C3=CC(=C(C=C3)O)O
Butizide (2279)

* No CASNo

* Butizide not found on commonchemistry - Butizide

* No ChemSpiderID

* PubChem: 16274

* No InChI

* SMILES: CC(C)CC1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl
Butoconazole (2281)

* No CASNo

* Butoconazole not found on commonchemistry - Butoconazole

* ChemSpiderID: 43192 (correct: 43192) - CORRECT - Retrieved data from ChemSpider

* PubChem: 47472

* No InChI - (ChemSpider: | InChI=InChI=1/C19H17Cl3N2S/c20-15-7-4-14(5-8-15)6-9-16(12-24-11-10-23-13-24)25-19-17(21)2-1-3-18(19)22/h1-5,7-8,10-11,13,16H,6,9,12H2 )

* No SMILES - (ChemSpider: | smiles=Clc1ccc(cc1)CCC(Sc2c(Cl)cccc2Cl)Cn3ccnc3 )
Butorphanol (2282)
```
Botcommand: addindex 358177930 Butorphanol
```
```
For index : Butorphanol=358177930
```
* 42408-82-2 -> 42408-82-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Butorphanol found on commonchemistry - Butorphanol
* 58786-99-5 (exact match)
Name in list

All names: [[[S-(R*,R*)]-2,3-dihidroxisuccinato de 17-(ciclobutilmetil)morfinan-3,14-diilo]], [[[S-(R*,R*)]-2,3-dihydroxysuccinate de 17-(cyclobutylmethyl)morphinan-3,14-diyle]], [[17-(cyclobutylmethyl)morphinan-3,14-diyl [S-(R*,R*)]-2,3-dihydroxysuccinate]], [[17-(Cyclobutylmethyl)morphinan-3,14-diyl-[S-(R*,R*)]-2,3-dihydroxysuccinat]], [[butorphanol tartrate]], Butorphic, [[l-butorphanol tartrate]], Levo-BC 2627 tartrate, Moradol, Morphinan-3,14-diol, 17-(cyclobutylmethyl)-, (2S,3S)-2,3-dihydroxybutanedioate (1:1), Morphinan-3,14-diol, 17-(cyclobutylmethyl)-, (2S,3S)-2,3-dihydroxybutanedioate (1:1) (salt), [[Morphinan-3,14-diol, 17-(cyclobutylmethyl)-, [S-(R*,R*)]-2,3-dihydroxybutanedioate (1:1) (salt)]], NIH 10275, Stadol, Torate, Torbugesic

* ChemSpiderID: 16735714 (correct: 16735714) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5361092

* No InChI - (ChemSpider: | InChI=InChI=1/C21H29NO2/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15/h6-7,13,15,19,23-24H,1-5,8-12,14H2/t19-,20+,21-/m1/s1 )

* No SMILES - (ChemSpider: | smiles=Oc3ccc4C[C@H]1N(CC[C@@]2(CCCC[C@@]12O)c4c3)CC5CCC5 )
Butriptyline (2283)
```
Botcommand: addindex 352018738 Butriptyline
```
```
For index : Butriptyline=352018738
```
* 35941-65-2 -> 35941-65-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Butriptyline not found on commonchemistry - Butriptyline

* ChemSpiderID: 20462 (correct: 20462) - CORRECT - Retrieved data from ChemSpider

* PubChem: 21772

* No InChI - (ChemSpider: | InChI=InChI=1/C21H27N/c1-16(15-22(2)3)14-21-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)21/h4-11,16,21H,12-15H2,1-3H3 )

* No SMILES - (ChemSpider: | smiles=c1cc3c(cc1)CCc2c(cccc2)C3CC(C)CN(C)C )
Butyl_PBD (2284)
```
Botcommand: addindex 363534660 Butyl_PBD
```
```
For index : Butyl_PBD=363534660
```
* 15082-28-7 -> 15082-28-7 - NOT VERIFIED

* CAS found on commonchemistry - 15082-28-7 - name not in list
All names: 1,3,4-Oxadiazole, 2-(4-biphenylyl)-5-(p-tert-butylphenyl)-, [[1,3,4-Oxadiazole, 2-[1,1'-biphenyl]-4-yl-5-[4-(1,1-dimethylethyl)phenyl]-]], [[1,3,4-Oxadiazole, 2-[1,1'-biphenyl]-4-yl-5-[4-(1,1-dimethylethyl)phenyl]-]], 2-(4-Biphenyl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole, 2-(4-Biphenylyl)-5-(4-t-butylphenyl)-1,3,4-oxadiazole, 2-(4-biphenylyl)-5-(4-terc-butilfenil)-1,3,4-oxadiazolo, 2-(4-Biphenylyl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazol, 2-(4-Biphenylyl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole, 2-(4-Biphenylyl)-5-(4-tertiary-butylphenyl)-1,3,4-oxadiazole, 2-(4-tert-Butylphenyl)-5-(4'-biphenyl)-1,3,4-oxadiazole, 2-(4-tert-Butylphenyl)-5-(4-biphenyl)-1,3,4-oxadiazole, 2-(4'-tert-Butylphenyl)-5-(4''-biphenylyl)-1,3,4-oxadiazole, 2-(4'-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole, 2-(4-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole, [[2-[1,1'-Biphenyl]-4-yl-5-(4'-tert-butyl)phenyl-1,3,4-oxadiazole]], 2-tert-Butylphenyl-5-biphenyl-1,3,4-oxadiazole, 5-(4-tert-Butylphenyl)-2-(biphenyl-4-yl)-1,3,4-oxadiazole, BPBD, Butyl-PBD, NSC 158164, PBD, tert-Butylphenyl-p-biphenyloxadiazole

* Butyl+PBD not found on commonchemistry - Butyl+PBD

* ChemSpiderID: 76483 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C24H22N2O/c1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16H,1-3H3 - (ChemSpider: | InChI=InChI=1/C24H22N2O/c1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-16H,1-3H3 )

* No SMILES - (ChemSpider: | SMILES=n1nc(oc1c3ccc(c2ccccc2)cc3)c4ccc(cc4)C(C)(C)C )
Butyl_butyrate (2286)
```
Botcommand: addindex 358659079 Butyl_butyrate
```
```
For index : Butyl_butyrate=358659079
```
* 109-21-7 -> 109-21-7 - NOT VERIFIED

* CAS found on commonchemistry - 109-21-7 - name in list
All names: 1-Butyl butyrate, BUTANOATE, BUTYL, Butanoic acid, butyl ester, butirato de butilo, BUTTERSAEURE-BUTYLESTER, Butyl butanoate, Butyl butylate, butyl butyrate, Butylbutyrat, Butyrate de butyle, Butyric acid n-butyl ester, Butyric acid, butyl ester, n-Butyl butanoate, n-Butyl butyrate, n-Butyl n-butyrate, NSC 8458

* Butyl+butyrate found on commonchemistry - Butyl+butyrate
* 109-21-7 (exact match) Matches CAS (109-21-7) on page
Name in list

All names: [[1-butyl butyrate]], BUTANOATE, BUTYL, Butanoic acid, butyl ester, butirato de butilo, BUTTERSAEURE-BUTYLESTER, Butyl butanoate, Butyl butylate, [[butyl butyrate]], Butylbutyrat, Butyrate de butyle, Butyric acid n-butyl ester, Butyric acid, butyl ester, n-Butyl butanoate, [[n-butyl butyrate]], n-Butyl n-butyrate, NSC 8458

* No ChemSpiderID

* PubChem: 7983

* InChI: 1/C8H16O2/c1-3-5-7-10-8(9)6-4-2/h3-7H2,1-2H3

* SMILES: CCCCOC(=O)CCC
Butyl_cyanoacrylate (2287)
```
Botcommand: addindex 359866931 Butyl_cyanoacrylate
```
```
For index : Butyl_cyanoacrylate=359866931
```
* 6606-65-1 -> 6606-65-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyl+cyanoacrylate not found on commonchemistry - Butyl+cyanoacrylate

* ChemSpiderID: 21607 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C8H11NO2/c1-3-4-5-11-8(10)7(2)6-9/h2-5H2,1H3 - (ChemSpider: | InChI=InChI=1/C8H11NO2/c1-3-4-5-11-8(10)7(2)6-9/h2-5H2,1H3 )

* SMILES: N#C/C(=C)C(=O)OCCCC - (ChemSpider: | SMILES=N#C/C(=C)C(=O)OCCCC )
Butyl_nitrate (2289)
```
Botcommand: addindex 348025562 Butyl_nitrate
```
```
For index : Butyl_nitrate=348025562
```
* 928-45-0 -> 928-45-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyl+nitrate not found on commonchemistry - Butyl+nitrate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Butyl_nitrite (2290)
```
Botcommand: addindex 358657346 Butyl_nitrite
```
```
For index : Butyl_nitrite=358657346
```
* 544-16-1 -> 544-16-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyl+nitrite found on commonchemistry - Butyl+nitrite
* 110-46-3 (exact match)
Name in list

All names: 3-Methylbutanol nitrite, 3-Methylbutyl ester, nitrous acid, [[3-Methylbutyl nitrite]], AMYL NITRITE, amyl nitrite, mixed isomers, Amylnitrit, Mischung von Isomeren, Aspiral, Isoamyl nitrite, Isopentyl alcohol nitrite, Isopentyl alcohol, nitrite, Isopentyl nitrite, ISOPENTYLNITRIT, Nitramyl, nitrite d'amyle, melange d'isomeres, Nitrite de 3-methylbutyle, nitrito de amilo, mezcla de isomeros, Nitrous acid, 3-methyl butyl ester, Nitrous acid, 3-methylbutyl ester, Nitrous acid, isopentyl ester, NSC 7903, Pentyl nitrite, UN 1113, Vaporole

* No ChemSpiderID

* PubChem: 10996

* No InChI

* No SMILES
Butylated_hydroxyanisole (2291)
```
Botcommand: addindex 359227765 Butylated_hydroxyanisole
```
```
For index : Butylated_hydroxyanisole=359227765
```
* 25013-16-5 -> 25013-16-5 - NOT VERIFIED

* CAS found on commonchemistry - 25013-16-5 - name in list
All names: (1,1-Dimethylethyl)-4-methoxyphenol, 1,1-(Dimethylethyl)-4-methoxyphenol, 2(3)-TERT.-BUTYL-4-HYDROXY-ANISOL (ISOMERENGEMISCH), 2(3)-tert-Butyl-4-hydroxyanisole, Antioxyne B, BHA, BHA (antioxidant), BOA, BOA (antioxidant), Butylated hydroxyanisole, Butylhydroxyanisole, E 320, Embanox, Phenol, (1,1-dimethylethyl)-4-methoxy-, Phenol, tert-butyl-4-methoxy-, Protex, Sustane 1F, t-Butyl-p-hydroxyanisole, Tenox BHA, terc-butil-4-metoxifenol, tert-Butyl-4-hydroxyanisole, tert-Butyl-4-methoxyphenol, tert-Butylhydroxyanisole, tert-Butyl-p-hydroxyanisole

* Butylated+hydroxyanisole found on commonchemistry - Butylated+hydroxyanisole
* 25013-16-5 (exact match) Matches CAS (25013-16-5) on page
Name in list

All names: (1,1-Dimethylethyl)-4-methoxyphenol, 1,1-(Dimethylethyl)-4-methoxyphenol, 2(3)-TERT.-BUTYL-4-HYDROXY-ANISOL (ISOMERENGEMISCH), 2(3)-tert-Butyl-4-hydroxyanisole, Antioxyne B, BHA, BHA (antioxidant), BOA, BOA (antioxidant), [[butylated hydroxyanisole]], Butylhydroxyanisole, E 320, Embanox, Phenol, (1,1-dimethylethyl)-4-methoxy-, Phenol, tert-butyl-4-methoxy-, Protex, Sustane 1F, t-Butyl-p-hydroxyanisole, Tenox BHA, terc-butil-4-metoxifenol, tert-Butyl-4-hydroxyanisole, tert-Butyl-4-methoxyphenol, tert-Butylhydroxyanisole, tert-Butyl-p-hydroxyanisole

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Butylone (2293)
```
Botcommand: addindex 361693125 Butylone
```
```
For index : Butylone=361693125
```
* 17762-90-2 -> 17762-90-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Butylone found on commonchemistry - Butylone
* 57-33-0 (exact match)
Name in list

All names: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, monosodium salt, 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-(1-methylbutyl)-, sodium salt (1:1), 5-Ethyl-5-(1-methylbutyl) barbituric acid sodium salt, 5-Ethyl-5-(methylbutyl)-2,4,6(1H,3H,5H)-pyrimidinetrione monosodium salt, 844, Auropan, Barbituric acid, 5-ethyl-5-(1-methylbutyl)-, sodium salt, Barpental, Biosedan, [[butylone]], Diabutal, Embutal, Etaminal sodium, Ethaminal sodium, Euthanyl, Euthatal, Isobarb, Mebubarbital sodium, Mebumal sodium, Mebunat, Napental, Narcoren, Nembutal sodium, NSC 10816, Pacifan, Pental, pentobarbital sodico, Pentobarbital sodique, pentobarbital sodium, Pentobarbitalnatrium, Pentobarbitone sodium, Pentonal, Pentone, Praecicalm, RS-Pentobarbital sodium, Sagatal, Sodium 5-ethyl-5-(1-methylbutyl)barbiturate, Sodium ethaminal, Sodium nembutal, Sodium pental, Sodium pentobarbital, Sodium pentobarbitone, Sodium pentobarbiturate, Sodium-Pent, Soluble pentobarbital, Somnopentyl, Somnotol, Sopental, Sotyl, Vetbutal, V-Pento

* ChemSpiderID: 21073070 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C12H15NO3.ClH/c1-3-9(13-2)12(14)8-4-5-10-11(6-8)16-7-15-10;/h4-6,9,13H,3,7H2,1-2H3;1H )

* No SMILES - (ChemSpider: | smiles=Cl.CCC(NC)C(=O)c1ccc2OCOc2c1 )
Butylscopolamine (2295)
```
Botcommand: addindex 362674125 Butylscopolamine
```
```
For index : Butylscopolamine=362674125
```
* 146-64-4 -> 146-64-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Butylscopolamine not found on commonchemistry - Butylscopolamine

* ChemSpiderID: 16736107 (correct: 16736107) - CORRECT - Retrieved data from ChemSpider

* PubChem: 160883

* No InChI - (ChemSpider: | InChI=InChI=1/C21H30NO4.BrH/c1-3-4-10-22(2)17-11-15(12-18(22)20-19(17)26-20)25-21(24)16(13-23)14-8-6-5-7-9-14;/h5-9,15-20,23H,3-4,10-13H2,1-2H3;1H/q+1;/p-1/t15-,16-,17-,18+,19-,20+,22?;/m1./s1 )

* No SMILES - (ChemSpider: | smiles=[Br-].OC[C@H](c1ccccc1)C(=O)O[C@@H]2C[C@@H]3[C@H]4O[C@H]4[C@H](C2)[N+]3(C)CCCC )
Butyltin_trichloride (2296)
```
Botcommand: addindex 275401132 Butyltin_trichloride
```
```
For index : Butyltin_trichloride=275401132
```
* 1118-46-3 -> 1118-46-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyltin+trichloride not found on commonchemistry - Butyltin+trichloride

* No ChemSpiderID

* PubChem: 14236

* No InChI

* SMILES: CCCC[Sn](Cl)(Cl)Cl
Butyltolylquinuclidine (2297)

* No CASNo

* Butyltolylquinuclidine not found on commonchemistry - Butyltolylquinuclidine

* No ChemSpiderID

* PubChem: 9903250

* No InChI

* No SMILES
Butynamine (2298)
```
Botcommand: addindex 351858523 Butynamine
```
```
For index : Butynamine=351858523
```
* 3735-65-7 -> 3735-65-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Butynamine not found on commonchemistry - Butynamine

* ChemSpiderID: 164936 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 189910

* No InChI - (ChemSpider: | InChI=InChI=1/C10H19N/c1-8-10(5,6)11(7)9(2,3)4/h1H,2-7H3 )

* No SMILES - (ChemSpider: | smiles=C#CC(N(C(C)(C)C)C)(C)C )
Butyramide (2300)
```
Botcommand: addindex 265758105 Butyramide
```
```
For index : Butyramide=265758105
```
* 541-35-5 -> 541-35-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyramide found on commonchemistry - Butyramide
* 81-13-0 (Formula: C9H19NO4; Name: Butanamide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-, (2R)-)

* 102-01-2 (Formula: C10H11NO2; Name: Butanamide, 3-oxo-N-phenyl-)

* 362-74-3 (Formula: C18H24N5O8P; Name: Adenosine, N-(1-oxobutyl)-, cyclic 3',5'-(hydrogen phosphate) 2'-butanoate)

* 667-83-4 (Formula: C11H23NO4; Name: Butanamide, N-(3-ethoxypropyl)-2,4-dihydroxy-3,3-dimethyl-, (2R)-)

* 3737-09-5 (Formula: C21H29N3O; Name: 2-Pyridineacetamide, Î±-[2-[bis(1-methylethyl)amino]ethyl]-Î±-phenyl-)

* 6358-31-2 (Formula: C18H18N4O6; Name: Butanamide, 2-[(2-methoxy-4-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo-)

* 16485-10-2 (Formula: C9H19NO4; Name: Butanamide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-)

* 16816-67-4 (Formula: C22H42N4O8S2; Name: Butanamide, N,N'-[dithiobis[2,1-ethanediylimino(3-oxo-3,1-propanediyl)]]bis[2,4-dihydroxy-3,3-dimethyl-, (2R,2'R)-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCCC(N)=O

2301 to 2350

Butyryl_chloride (2305)
```
Botcommand: addindex 358649995 Butyryl_chloride
```
```
For index : Butyryl_chloride=358649995
```
* 141-75-3 -> 141-75-3 - NOT VERIFIED

* CAS found on commonchemistry - 141-75-3 - name in list
All names: 2-Ethylacetyl chloride, Butanoyl chloride, Butyric acid chloride, Butyric chloride, Butyroyl chloride, butyryl chloride, Butyrylchlorid, Chlorure de butyryle, cloruro de butirilo, n-Butanoyl chloride, n-Butyroyl chloride, n-Butyryl chloride, UN 2353

* Butyryl+chloride found on commonchemistry - Butyryl+chloride
* 141-75-3 (Formula: C4H7ClO; Name: Butanoyl chloride) Matches CAS (141-75-3) on page

* 79-30-1 (Formula: C4H7ClO; Name: Propanoyl chloride, 2-methyl-)

* 108-12-3 (Formula: C5H9ClO; Name: Butanoyl chloride, 3-methyl-)

* 4635-59-0 (Formula: C4H6Cl2O; Name: Butanoyl chloride, 4-chloro-)

* ChemSpiderID: 8523 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C4H7ClO/c1-2-3-4(5)6/h2-3H2,1H3 - (ChemSpider: | InChI=InChI=1/C4H7ClO/c1-2-3-4(5)6/h2-3H2,1H3 )

* SMILES: ClC(=O)CCC - (ChemSpider: | SMILES=ClC(=O)CCC )
Butyryl_phosphate (2306)
```
Botcommand: addindex 275401394 Butyryl_phosphate
```
```
For index : Butyryl_phosphate=275401394
```
* 4378-06-7 -> 4378-06-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyryl+phosphate not found on commonchemistry - Butyryl+phosphate

* No ChemSpiderID

* PubChem: 266

* No InChI

* SMILES: CCCC(=O)OP(=O)(O)O
Butyryl-CoA (2307)
```
Botcommand: addindex 345107050 Butyryl-CoA
```
```
For index : Butyryl-CoA=345107050
```
* 2140-48-9 -> 2140-48-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyryl+CoA not found on commonchemistry - Butyryl+CoA

* No ChemSpiderID

* PubChem: 439173

* No InChI

* No SMILES
Butyrylcholine (2308)
```
Botcommand: addindex 336931655 Butyrylcholine
```
```
For index : Butyrylcholine=336931655
```
* 3922-86-9 -> 3922-86-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Butyrylcholine found on commonchemistry - Butyrylcholine
* 9001-08-5 (exact match)
Name in list

All names: Acylcholine acylhydrolase, Benzoylcholinesterase, [[butyrylcholine esterase]], [[butyrylcholinesterase]], Choline esterase, Cholinesterase, E.C. 3.1.1.8, E.C. 3.1.1.9, esterasa, colina, [[Esterase, butyrylcholine]], Esterase, Cholin-, Esterase, choline, Propionylcholinesterase, Protexia, Pseudocholinesterase

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(CCC)OCC[N+](C)(C)C
C-8813 (2309)

* No CASNo

* C found on commonchemistry - C
* 50-00-0 (Formula: CH2O; Name: Formaldehyde)

* 50-01-1 (Formula: CH5N3.ClH; Name: Guanidine, monohydrochloride)

* 50-02-2 (Formula: C22H29FO5; Name: Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11Î²,16Î±)-)

* 50-03-3 (Formula: C23H32O6; Name: Pregn-4-ene-3,20-dione, 21-(acetyloxy)-11,17-dihydroxy-, (11Î²)-)

* 50-04-4 (Formula: C23H30O6; Name: Pregn-4-ene-3,11,20-trione, 21-(acetyloxy)-17-hydroxy-)

* 50-06-6 (Formula: C12H12N2O3; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl-)

* 50-07-7 (Formula: C15H18N4O5; Name: Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-)

* 50-09-9 (Formula: C12H16N2O3.Na; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,5-dimethyl-, sodium salt)

* 50-10-2 (Formula: C21H34NO3.Br; Name: Ethanaminium, 2-[(cyclohexylhydroxyphenylacetyl)oxy]-N,N-diethyl-N-methyl-, bromide)

* 50-11-3 (Formula: C9H14N2O3; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-diethyl-1-methyl-)

* No ChemSpiderID

* PubChem: 11058633

* No InChI

* No SMILES
C-peptide (2310)
```
Botcommand: addindex 364731398 C-peptide
```
```
For index : C-peptide=364731398
```
* 59112-80-0 -> 59112-80-0 - NOT VERIFIED

* CAS not found on commonchemistry

* C+peptide found on commonchemistry - C+peptide
* 106-57-0 (Formula: C4H6N2O2; Name: 2,5-Piperazinedione)

* 124584-08-3 (Formula: C143H244N50O42S4; Name: Brain natriuretic peptide-32, (human))

* No ChemSpiderID

* PubChem: 16132309

* No InChI

* No SMILES
C55-isoprenyl_pyrophosphate (2311)
```
Botcommand: addindex 349443638 C55-isoprenyl_pyrophosphate
```
```
For index : C55-isoprenyl_pyrophosphate=349443638
```
* 31867-59-1 -> 31867-59-1 - NOT VERIFIED

* CAS not found on commonchemistry

* C+isoprenyl+pyrophosphate not found on commonchemistry - C+isoprenyl+pyrophosphate

* No ChemSpiderID

* PubChem: 5280604

* No InChI

* SMILES: CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)/C)/C)/C)/C)/C)/C)/C)/C)/C)/C)C
CAPS_(buffer) (2312)
```
Botcommand: addindex 299501157 CAPS_(buffer)
```
```
For index : CAPS_(buffer)=299501157
```
* 1135-40-6 -> 1135-40-6 - NOT VERIFIED

* CAS not found on commonchemistry

* CAPS+buffer not found on commonchemistry - CAPS+buffer

* No ChemSpiderID

* PubChem: 70815

* No InChI

* SMILES: C1CCC(CC1)NCCCS(=O)(=O)O
CAR-226,086 (2313)
```
Botcommand: addindex 352297551 CAR-226,086
```
```
For index : CAR-226,086=352297551
```
* 64471-85-8 -> 64471-85-8 - NOT VERIFIED

* CAS not found on commonchemistry

* CAR found on commonchemistry - CAR
* 50-07-7 (Formula: C15H18N4O5; Name: Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-)

* 50-23-7 (Formula: C21H30O5; Name: Pregn-4-ene-3,20-dione, 11,17,21-trihydroxy-, (11Î²)-)

* 50-32-8 (Formula: C20H12; Name: Benzo[a]pyrene)

* 50-36-2 (Formula: C17H21NO4; Name: 8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-(benzoyloxy)-8-methyl-, methyl ester, (1R,2R,3S,5S)-)

* 50-37-3 (Formula: C20H25N3O; Name: Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-6-methyl-, (8Î²)-)

* 50-41-9 (Formula: C26H28ClNO.C6H8O7; Name: Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1))

* 50-55-5 (Formula: C33H40N2O9; Name: Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3Î²,16Î²,17Î±,18Î²,20Î±)-)

* 50-57-7 (Formula: C46H65N13O12S2; Name: Vasopressin, 8-L-lysine-)

* 50-59-9 (Formula: C19H17N3O4S2; Name: Pyridinium, 1-[[(6R,7R)-2-carboxy-8-oxo-7-[(2-thienylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-, inner salt)

* 50-70-4 (Formula: C6H14O6; Name: D-Glucitol)

* No ChemSpiderID

* PubChem: 3049107

* No InChI

* No SMILES
CAR-301,060 (2314)

* No CASNo

* CAR found on commonchemistry - CAR
* 50-07-7 (Formula: C15H18N4O5; Name: Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-)

* 50-23-7 (Formula: C21H30O5; Name: Pregn-4-ene-3,20-dione, 11,17,21-trihydroxy-, (11Î²)-)

* 50-32-8 (Formula: C20H12; Name: Benzo[a]pyrene)

* 50-36-2 (Formula: C17H21NO4; Name: 8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-(benzoyloxy)-8-methyl-, methyl ester, (1R,2R,3S,5S)-)

* 50-37-3 (Formula: C20H25N3O; Name: Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-6-methyl-, (8Î²)-)

* 50-41-9 (Formula: C26H28ClNO.C6H8O7; Name: Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1))

* 50-55-5 (Formula: C33H40N2O9; Name: Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3Î²,16Î²,17Î±,18Î²,20Î±)-)

* 50-57-7 (Formula: C46H65N13O12S2; Name: Vasopressin, 8-L-lysine-)

* 50-59-9 (Formula: C19H17N3O4S2; Name: Pyridinium, 1-[[(6R,7R)-2-carboxy-8-oxo-7-[(2-thienylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-, inner salt)

* 50-70-4 (Formula: C6H14O6; Name: D-Glucitol)

* No ChemSpiderID

* PubChem: 44149220

* No InChI

* No SMILES
CAR-302,196 (2315)
```
Botcommand: addindex 352297888 CAR-302,196
```
```
For index : CAR-302,196=352297888
```
* 53034-67-6 -> 53034-67-6 - NOT VERIFIED

* CAS not found on commonchemistry

* CAR found on commonchemistry - CAR
* 50-07-7 (Formula: C15H18N4O5; Name: Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-)

* 50-23-7 (Formula: C21H30O5; Name: Pregn-4-ene-3,20-dione, 11,17,21-trihydroxy-, (11Î²)-)

* 50-32-8 (Formula: C20H12; Name: Benzo[a]pyrene)

* 50-36-2 (Formula: C17H21NO4; Name: 8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-(benzoyloxy)-8-methyl-, methyl ester, (1R,2R,3S,5S)-)

* 50-37-3 (Formula: C20H25N3O; Name: Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-6-methyl-, (8Î²)-)

* 50-41-9 (Formula: C26H28ClNO.C6H8O7; Name: Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1))

* 50-55-5 (Formula: C33H40N2O9; Name: Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-, methyl ester, (3Î²,16Î²,17Î±,18Î²,20Î±)-)

* 50-57-7 (Formula: C46H65N13O12S2; Name: Vasopressin, 8-L-lysine-)

* 50-59-9 (Formula: C19H17N3O4S2; Name: Pyridinium, 1-[[(6R,7R)-2-carboxy-8-oxo-7-[(2-thienylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-, inner salt)

* 50-70-4 (Formula: C6H14O6; Name: D-Glucitol)

* No ChemSpiderID

* PubChem: 198289

* No InChI

* No SMILES
CB-13 (2316)
```
Botcommand: addindex 354059533 CB-13
```
```
For index : CB-13=354059533
```
* 432047-72-8 -> 432047-72-8 - NOT VERIFIED

* CAS not found on commonchemistry

* CB found on commonchemistry - CB
* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 52-24-4 (Formula: C6H12N3PS; Name: Aziridine, 1,1',1-phosphinothioylidynetris-)

* 53-19-0 (Formula: C14H10Cl4; Name: Benzene, 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethyl]-)

* 53-39-4 (Formula: C19H30O3; Name: Cyclopenta[5,6]naphtho[1,2-c]pyran-2(1H)-one, tetradecahydro-7-hydroxy-4a,6a,7-trimethyl-, (4aS,4bS,6aS,7S,9aS,9bR,11aS)-)

* 55-98-1 (Formula: C6H14O6S2; Name: 1,4-Butanediol, dimethanesulfonate)

* 61-00-7 (Formula: C19H22N2OS; Name: Ethanone, 1-[10-[3-(dimethylamino)propyl]-10H-phenothiazin-2-yl]-)

* 66-75-1 (Formula: C8H11Cl2N3O2; Name: 2,4(1H,3H)-Pyrimidinedione, 5-[bis(2-chloroethyl)amino]-)

* 71-58-9 (Formula: C24H34O4; Name: Pregn-4-ene-3,20-dione, 17-(acetyloxy)-6-methyl-, (6Î±)-)

* 71-67-0 (Formula: C20H10Br4O10S2.2Na; Name: Benzenesulfonic acid, 3,3'-(4,5,6,7-tetrabromo-3-oxo-1(3H)-isobenzofuranylidene)bis[6-hydroxy-, disodium salt)

* 74-11-3 (Formula: C7H5ClO2; Name: Benzoic acid, 4-chloro-)

* No ChemSpiderID

* PubChem: 9799417

* No InChI

* No SMILES
CCG-4986 (2317)

* No CASNo

* CCG not found on commonchemistry - CCG

* No ChemSpiderID

* PubChem: 1328227

* No InChI

* No SMILES
CCK-4 (2318)
```
Botcommand: addindex 327443205 CCK-4
```
```
For index : CCK-4=327443205
```
* 1947-37-1 -> 1947-37-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CCK found on commonchemistry - CCK
* 25126-32-3 (exact match)
Name not in list

All names: Asp-Tyr(SO3H)-Met-Gly-Trp-Met-Asp-Phe-NH2, Caerulein, 1-de(5-oxo-L-proline)-2-de-L-glutamine-5-L-methionine-, Cholecystokinin C-terminal octapeptide, Cholecystokinin octapeptide (26-33 sulfated), Cholecystokinin-(26-33)-amide, Cholecystokinin-8 (chicken), Cholecystokinin-8 (pig), Cholecystokinin-8 (Squalus acanthias), Cholecystokinin-8 (swine), Cholecystokinin-pancreozymin (swine intestine C-terminal octapeptide), Cholecystokinin-pancreozymin C-terminal octapeptide, [[Human cck-8]], L-Phenylalaninamide, L-Î±-aspartyl-O-sulfo-L-tyrosyl-L-methionylglycyl-L-tryptophyl-L-methionyl-L-Î±-aspartyl-, Sincalid, sincalida, sincalide, SQ 19844

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
CCPA_(biochemistry) (2319)
```
Botcommand: addindex 360223879 CCPA_(biochemistry)
```
```
For index : CCPA_(biochemistry)=360223879
```
* 37739-05-2 -> 37739-05-2 - NOT VERIFIED

* CAS not found on commonchemistry

* CCPA+biochemistry not found on commonchemistry - CCPA+biochemistry

* ChemSpiderID: 110356 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 123807

* InChI: 1/C15H20ClN5O4/c16-15-19-12(18-7-3-1-2-4-7)9-13(20-15)21(6-17-9)14-11(24)10(23)8(5-22)25-14/h6-8,10-11,14,22-24H,1-5H2,(H,18,19,20)/t8-,10-,11-,14-/m1/s1 - (ChemSpider: | InChI=InChI=1/C15H20ClN5O4/c16-15-19-12(18-7-3-1-2-4-7)9-13(20-15)21(6-17-9)14-11(24)10(23)8(5-22)25-14/h6-8,10-11,14,22-24H,1-5H2,(H,18,19,20)/t8-,10-,11-,14-/m1/s1 )

* SMILES: Clc1nc(c2ncn(c2n1)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)CO)NC4CCCC4 - (ChemSpider: | SMILES=Clc1nc(c2ncn(c2n1)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)CO)NC4CCCC4 )
CDB-4124 (2320)
```
Botcommand: addindex 356328380 CDB-4124
```
```
For index : CDB-4124=356328380
```
* 136960-00-4 -> 136960-00-4 - NOT VERIFIED

* CAS not found on commonchemistry

* CDB found on commonchemistry - CDB
* 58-18-4 (Formula: C20H30O2; Name: Androst-4-en-3-one, 17-hydroxy-17-methyl-, (17Î²)-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 87-90-1 (Formula: C3Cl3N3O3; Name: 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trichloro-)

* 122-18-9 (Formula: C25H46N.Cl; Name: Benzenemethanaminium, N-hexadecyl-N,N-dimethyl-, chloride)

* 693-33-4 (Formula: C20H41NO2; Name: 1-Hexadecanaminium, N-(carboxymethyl)-N,N-dimethyl-, inner salt)

* 1746-01-6 (Formula: C12H4Cl4O2; Name: Dibenzo[b,e][1,4]dioxin, 2,3,7,8-tetrachloro-)

* 2893-78-9 (Formula: C3HCl2N3O3.Na; Name: 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt)

* 7789-42-6 (Formula: Br2Cd; Name: Cadmium bromide, (CdBr2))

* ChemSpiderID: 7981950 (correct: 7981950) - CORRECT - Retrieved data from ChemSpider

* PubChem: 9806190

* No InChI - (ChemSpider: | InChI=InChI=1/C31H39NO5/c1-19(33)37-31(28(35)18-36-5)15-14-27-25-12-8-21-16-23(34)11-13-24(21)29(25)26(17-30(27,31)2)20-6-9-22(10-7-20)32(3)4/h6-7,9-10,16,25-27H,8,11-15,17-18H2,1-5H3/t25-,26+,27-,30-,31-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=O=C5\C=C3/C(=C2/[C@@H](c1ccc(N(C)C)cc1)C[C@@]4([C@@](OC(=O)C)(C(=O)COC)CC[C@H]4[C@@H]2CC3)C)CC5 )
CDPPB (2321)
```
Botcommand: addindex 360227647 CDPPB
```
```
For index : CDPPB=360227647
```
* 781652-57-1 -> 781652-57-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CDPPB not found on commonchemistry - CDPPB

* No ChemSpiderID

* PubChem: 11245456

* No InChI

* No SMILES
CGP_52608 (2322)
```
Botcommand: addindex 338855789 CGP_52608
```
```
For index : CGP_52608=338855789
```
* 87958-67-6 -> 87958-67-6 - NOT VERIFIED

* CAS not found on commonchemistry

* CGP found on commonchemistry - CGP
* 14320-04-8 (Formula: C32H16N8Zn; Name: Zinc, [29H,31H-phthalocyaninato(2-)-ÎºN29,ÎºN30,ÎºN31,ÎºN32]-, (SP-4-1)-)

* 25122-46-7 (Formula: C25H32ClFO5; Name: Pregna-1,4-diene-3,20-dione, 21-chloro-9-fluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-, (11Î²,16Î²)-)

* 37350-58-6 (Formula: ; Name: 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (Â±)-)

* 51384-51-1 (Formula: C15H25NO3; Name: 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-)

* 62996-74-1 (Formula: C28H26N4O3; Name: 9,13-Epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one, 2,3,10,11,12,13-hexahydro-10-methoxy-9-methyl-11-(methylamino)-, (9S,10R,11R,13R)-)

* 66852-54-8 (Formula: C25H31ClF2O5; Name: Pregna-1,4-diene-3,20-dione, 21-chloro-6,9-difluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-, (6Î±,11Î²,16Î²)-)

* 89365-50-4 (Formula: C25H37NO4; Name: 1,3-Benzenedimethanol, 4-hydroxy-Î±1-[[[6-(4-phenylbutoxy)hexyl]amino]methyl]-)

* ChemSpiderID: 4589397 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6509863

* InChI: 1/C8H12N4OS2/c1-3-4-12-6(13)5-15-8(12)11-10-7(14)9-2/h3H,1,4-5H2,2H3,(H2,9,10,14)/b11-8- - (ChemSpider: | InChI=InChI=1/C8H12N4OS2/c1-3-4-12-6(13)5-15-8(12)11-10-7(14)9-2/h3H,1,4-5H2,2H3,(H2,9,10,14)/b11-8- )

* SMILES: S=C(N\N=C1/SCC(=O)N1C\C=C)NC - (ChemSpider: | SMILES=S=C(N\N=C1/SCC(=O)N1C\C=C)NC )
CGP-37849 (2323)
```
Botcommand: addindex 228158996 CGP-37849
```
```
For index : CGP-37849=228158996
```
* 137424-81-8 -> 137424-81-8 - NOT VERIFIED

* CAS not found on commonchemistry

* CGP found on commonchemistry - CGP
* 14320-04-8 (Formula: C32H16N8Zn; Name: Zinc, [29H,31H-phthalocyaninato(2-)-ÎºN29,ÎºN30,ÎºN31,ÎºN32]-, (SP-4-1)-)

* 25122-46-7 (Formula: C25H32ClFO5; Name: Pregna-1,4-diene-3,20-dione, 21-chloro-9-fluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-, (11Î²,16Î²)-)

* 37350-58-6 (Formula: ; Name: 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (Â±)-)

* 51384-51-1 (Formula: C15H25NO3; Name: 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-)

* 62996-74-1 (Formula: C28H26N4O3; Name: 9,13-Epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one, 2,3,10,11,12,13-hexahydro-10-methoxy-9-methyl-11-(methylamino)-, (9S,10R,11R,13R)-)

* 66852-54-8 (Formula: C25H31ClF2O5; Name: Pregna-1,4-diene-3,20-dione, 21-chloro-6,9-difluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-, (6Î±,11Î²,16Î²)-)

* 89365-50-4 (Formula: C25H37NO4; Name: 1,3-Benzenedimethanol, 4-hydroxy-Î±1-[[[6-(4-phenylbutoxy)hexyl]amino]methyl]-)

* No ChemSpiderID

* PubChem: 5950212

* No InChI

* No SMILES
CGP-7930 (2324)

* No CASNo

* CGP found on commonchemistry - CGP
* 14320-04-8 (Formula: C32H16N8Zn; Name: Zinc, [29H,31H-phthalocyaninato(2-)-ÎºN29,ÎºN30,ÎºN31,ÎºN32]-, (SP-4-1)-)

* 25122-46-7 (Formula: C25H32ClFO5; Name: Pregna-1,4-diene-3,20-dione, 21-chloro-9-fluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-, (11Î²,16Î²)-)

* 37350-58-6 (Formula: ; Name: 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (Â±)-)

* 51384-51-1 (Formula: C15H25NO3; Name: 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-)

* 62996-74-1 (Formula: C28H26N4O3; Name: 9,13-Epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one, 2,3,10,11,12,13-hexahydro-10-methoxy-9-methyl-11-(methylamino)-, (9S,10R,11R,13R)-)

* 66852-54-8 (Formula: C25H31ClF2O5; Name: Pregna-1,4-diene-3,20-dione, 21-chloro-6,9-difluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-, (6Î±,11Î²,16Î²)-)

* 89365-50-4 (Formula: C25H37NO4; Name: 1,3-Benzenedimethanol, 4-hydroxy-Î±1-[[[6-(4-phenylbutoxy)hexyl]amino]methyl]-)

* No ChemSpiderID

* PubChem: 5024764

* No InChI

* No SMILES
CGS-12066A (2325)
```
Botcommand: addindex 360221457 CGS-12066A
```
```
For index : CGS-12066A=360221457
```
* 109028-10-6 -> 109028-10-6 - NOT VERIFIED

* CAS not found on commonchemistry

* CGS+A not found on commonchemistry - CGS+A

* No ChemSpiderID

* PubChem: 2689

* No InChI

* No SMILES
CGS-20625 (2326)
```
Botcommand: addindex 345361348 CGS-20625
```
```
For index : CGS-20625=345361348
```
* 111205-55-1 -> 111205-55-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CGS found on commonchemistry - CGS
* 1318-02-1 (Formula: Unspecified; Name: Zeolites, (synthetic))

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 11138-66-2 (Formula: Unspecified; Name: Xanthan gum)

* No ChemSpiderID

* PubChem: 163844

* No InChI

* No SMILES
CGS-21680 (2327)
```
Botcommand: addindex 360224157 CGS-21680
```
```
For index : CGS-21680=360224157
```
* 120225-54-9 -> 120225-54-9 - NOT VERIFIED

* CAS not found on commonchemistry

* CGS found on commonchemistry - CGS
* 1318-02-1 (Formula: Unspecified; Name: Zeolites, (synthetic))

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 11138-66-2 (Formula: Unspecified; Name: Xanthan gum)

* No ChemSpiderID

* PubChem: 3086599

* No InChI

* SMILES: CCNC(=O)[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=C(N=C3N)NCCC4=CC=C(C=C4)CCC(=O)O)O)O
CGS-9896 (2328)
```
Botcommand: addindex 345361374 CGS-9896
```
```
For index : CGS-9896=345361374
```
* 77779-36-3 -> 77779-36-3 - NOT VERIFIED

* CAS not found on commonchemistry

* CGS found on commonchemistry - CGS
* 1318-02-1 (Formula: Unspecified; Name: Zeolites, (synthetic))

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 11138-66-2 (Formula: Unspecified; Name: Xanthan gum)

* No ChemSpiderID

* PubChem: 108030

* No InChI

* No SMILES
CI-988 (2329)
```
Botcommand: addindex 349137868 CI-988
```
```
For index : CI-988=349137868
```
* 130332-27-3 -> 130332-27-3 - NOT VERIFIED

* CAS not found on commonchemistry

* CI found on commonchemistry - CI
* 50-00-0 (Formula: CH2O; Name: Formaldehyde)

* 50-06-6 (Formula: C12H12N2O3; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-phenyl-)

* 50-07-7 (Formula: C15H18N4O5; Name: Azirino[2',3':3,4]pyrrolo[1,2-a]indole-4,7-dione, 6-amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-, (1aS,8S,8aR,8bS)-)

* 50-09-9 (Formula: C12H16N2O3.Na; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,5-dimethyl-, sodium salt)

* 50-11-3 (Formula: C9H14N2O3; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-diethyl-1-methyl-)

* 50-14-6 (Formula: C28H44O; Name: 9,10-Secoergosta-5,7,10(19),22-tetraen-3-ol, (3Î²,5Z,7E,22E)-)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-21-5 (Formula: C3H6O3; Name: Propanoic acid, 2-hydroxy-)

* 50-27-1 (Formula: C18H24O3; Name: Estra-1,3,5(10)-triene-3,16,17-triol, (16Î±,17Î²)-)

* 50-29-3 (Formula: C14H9Cl5; Name: Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro-)

* No ChemSpiderID

* PubChem: 108186

* No InChI

* No SMILES
CL-218,872 (2330)
```
Botcommand: addindex 349391353 CL-218,872
```
```
For index : CL-218,872=349391353
```
* 66548-69-4 -> 66548-69-4 - NOT VERIFIED

* CAS not found on commonchemistry

* CL found on commonchemistry - CL
* 9003-56-9 (Formula: (C8H8.C4H6.C3H3N)x; Name: 2-Propenenitrile, polymer with 1,3-butadiene and ethenylbenzene)

* 50-01-1 (Formula: CH5N3.ClH; Name: Guanidine, monohydrochloride)

* 50-09-9 (Formula: C12H16N2O3.Na; Name: 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,5-dimethyl-, sodium salt)

* 50-10-2 (Formula: C21H34NO3.Br; Name: Ethanaminium, 2-[(cyclohexylhydroxyphenylacetyl)oxy]-N,N-diethyl-N-methyl-, bromide)

* 50-14-6 (Formula: C28H44O; Name: 9,10-Secoergosta-5,7,10(19),22-tetraen-3-ol, (3Î²,5Z,7E,22E)-)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-21-5 (Formula: C3H6O3; Name: Propanoic acid, 2-hydroxy-)

* 50-23-7 (Formula: C21H30O5; Name: Pregn-4-ene-3,20-dione, 11,17,21-trihydroxy-, (11Î²)-)

* 50-28-2 (Formula: C18H24O2; Name: Estra-1,3,5(10)-triene-3,17-diol (17Î²)-)

* 50-29-3 (Formula: C14H9Cl5; Name: Benzene, 1,1'-(2,2,2-trichloroethylidene)bis[4-chloro-)

* No ChemSpiderID

* PubChem: 107950

* No InChI

* No SMILES
CLD_chromophore (2331)

* No CASNo

* CLD+chromophore not found on commonchemistry - CLD+chromophore

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
CNQX (2332)
```
Botcommand: addindex 338549590 CNQX
```
```
For index : CNQX=338549590
```
* 115066-14-3 -> 115066-14-3 - NOT VERIFIED

* CAS not found on commonchemistry

* CNQX not found on commonchemistry - CNQX

* ChemSpiderID: 2951930 (correct: 2951930) - CORRECT - Retrieved data from ChemSpider

* PubChem: 3721046

* InChI: 1/C9H4N4O4/c10-3-4-1-5-6(2-7(4)13(16)17)12-9(15)8(14)11-5/h1-2H,(H,11,14)(H,12,15) - (ChemSpider: | InChI=InChI=1/C9H4N4O4/c10-3-4-1-5-6(2-7(4)13(16)17)12-9(15)8(14)11-5/h1-2H,(H,11,14)(H,12,15) )

* SMILES: [O-][N+](=O)c1c(C#N)cc2c(c1)NC(=O)C(=O)N2 - (ChemSpider: | SMILES=[O-][N+](=O)c1c(C#N)cc2c(c1)NC(=O)C(=O)N2 )
CP_47,497 (2333)
```
Botcommand: addindex 357751782 CP_47,497
```
```
For index : CP_47,497=357751782
```
* 70434-82-1 -> 70434-82-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* PubChem: 125835

* No InChI

* No SMILES
CP_55,244 (2334)
```
Botcommand: addindex 355283554 CP_55,244
```
```
For index : CP_55,244=355283554
```
* 79678-32-3 -> 79678-32-3 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* PubChem: 133254

* No InChI

* No SMILES
CP_55,940 (2335)
```
Botcommand: addindex 357347602 CP_55,940
```
```
For index : CP_55,940=357347602
```
* 83002-04-4 -> 83002-04-4 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* PubChem: 3086156

* No InChI

* No SMILES
CP-154,526 (2336)
```
Botcommand: addindex 345620785 CP-154,526
```
```
For index : CP-154,526=345620785
```
* 157286-86-7 -> 157286-86-7 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* PubChem: 5311055

* No InChI

* SMILES: CCCCN(CC)C1=NC(=NC2=C1C(=CN2C3=C(C=C(C=C3C)C)C)C)C
CP-39,332 (2337)
```
Botcommand: addindex 356427962 CP-39,332
```
```
For index : CP-39,332=356427962
```
* 61764-60-1 -> 61764-60-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* ChemSpiderID: 23189744 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 15657209

* No InChI - (ChemSpider: | InChI=InChI=1/C17H19N/c1-18-15-11-14-9-5-6-10-16(14)17(12-15)13-7-3-2-4-8-13/h2-10,15,17-18H,11-12H2,1H3 )

* No SMILES - (ChemSpider: | smiles=CNC1Cc2ccccc2C(C1)c3ccccc3 )
CP-532,903 (2338)
```
Botcommand: addindex 353453416 CP-532,903
```
```
For index : CP-532,903=353453416
```
* 457612-59-8 -> 457612-59-8 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: Clc3ccc(Cl)cc3CNc(c1nc4)ncnc1n4C(C(O)C2N)OC2C(=O)NC
CP-809,101 (2339)
```
Botcommand: addindex 353503223 CP-809,101
```
```
For index : CP-809,101=353503223
```
* 479683-64-2 -> 479683-64-2 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
CP-94,253 (2340)
```
Botcommand: addindex 353502875 CP-94,253
```
```
For index : CP-94,253=353502875
```
* 131084-35-0 -> 131084-35-0 - NOT VERIFIED

* CAS not found on commonchemistry

* CP found on commonchemistry - CP
* 7782-42-5 (Formula: C; Name: Graphite)

* 50-18-0 (Formula: C7H15Cl2N2O2P; Name: 2H-1,3,2-Oxazaphosphorin-2-amine, N,N-bis(2-chloroethyl)tetrahydro-, 2-oxide)

* 50-53-3 (Formula: C17H19ClN2S; Name: 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-dimethyl-)

* 50-98-6 (Formula: C10H15NO.ClH; Name: Benzenemethanol, Î±-[(1S)-1-(methylamino)ethyl]-, hydrochloride, (Î±R)-)

* 50-99-7 (Formula: C6H12O6; Name: D-Glucose)

* 52-53-9 (Formula: C27H38N2O4; Name: Benzeneacetonitrile, Î±-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-Î±-(1-methylethyl)-)

* 56-75-7 (Formula: C11H12Cl2N2O5; Name: Acetamide, 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]-)

* 58-08-2 (Formula: C8H10N4O2; Name: 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-)

* 58-22-0 (Formula: C19H28O2; Name: Androst-4-en-3-one, 17-hydroxy-, (17Î²)-)

* 58-90-2 (Formula: C6H2Cl4O; Name: Phenol, 2,3,4,6-tetrachloro-)

* No ChemSpiderID

* PubChem: 4029677

* No InChI

* No SMILES
CPCCOEt (2341)
```
Botcommand: addindex 360227436 CPCCOEt
```
```
For index : CPCCOEt=360227436
```
* 179067-99-3 -> 179067-99-3 - NOT VERIFIED

* CAS not found on commonchemistry

* CPCCOEt not found on commonchemistry - CPCCOEt

* No ChemSpiderID

* PubChem: 6278000

* No InChI

* No SMILES
CPHPC (2342)
```
Botcommand: addindex 338550280 CPHPC
```
```
For index : CPHPC=338550280
```
* 224624-80-0 -> 224624-80-0 - NOT VERIFIED

* CAS not found on commonchemistry

* CPHPC not found on commonchemistry - CPHPC

* ChemSpiderID: 111662 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 125516

* InChI: 1/C16H24N2O6/c19-13(17-9-3-5-11(17)15(21)22)7-1-2-8-14(20)18-10-4-6-12(18)16(23)24/h11-12H,1-10H2,(H,21,22)(H,23,24)/t11-,12-/m1/s1 - (ChemSpider: | InChI=InChI=1/C16H24N2O6/c19-13(17-9-3-5-11(17)15(21)22)7-1-2-8-14(20)18-10-4-6-12(18)16(23)24/h11-12H,1-10H2,(H,21,22)(H,23,24)/t11-,12-/m1/s1 )

* SMILES: O=C(O)[C@@H]2N(C(=O)CCCCC(=O)N1[C@@H](C(=O)O)CCC1)CCC2 - (ChemSpider: | SMILES=O=C(O)[C@@H]2N(C(=O)CCCCC(=O)N1[C@@H](C(=O)O)CCC1)CCC2 )
CR_gas (2343)
```
Botcommand: addindex 341482368 CR_gas
```
```
For index : CR_gas=341482368
```
* 257-07-8 -> 257-07-8 - NOT VERIFIED

* CAS not found on commonchemistry

* CR+gas not found on commonchemistry - CR+gas

* ChemSpiderID: 8858 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9213

* InChI: 1/C13H9NO/c1-3-7-12-10(5-1)9-14-11-6-2-4-8-13(11)15-12/h1-9H - (ChemSpider: | InChI=InChI=1/C13H9NO/c1-3-7-12-10(5-1)9-14-11-6-2-4-8-13(11)15-12/h1-9H )

* SMILES: N\1=C\c3c(Oc2c/1cccc2)cccc3 - (ChemSpider: | SMILES=N\1=C\c3c(Oc2c/1cccc2)cccc3 )
CRL-40,941 (2344)

* No CASNo

* CRL found on commonchemistry - CRL
* 9004-96-0 (Formula: (C2H4O)nC18H34O2; Name: Poly(oxy-1,2-ethanediyl), Î±-[(9Z)-1-oxo-9-octadecenyl]-Ï‰-hydroxy-)

* 9005-08-7 (Formula: (C2H4O)nC36H70O3; Name: Poly(oxy-1,2-ethanediyl), Î±-(1-oxooctadecyl)-Ï‰-[(1-oxooctadecyl)oxy]-)

* 10101-52-7 (Formula: H4O4Si.Zr; Name: Silicic acid, (H4SiO4), zirconium(4+) salt (1:1))

* 12017-94-6 (Formula: CrLaO3; Name: Chromium lanthanum oxide, (CrLaO3))

* 68693-11-8 (Formula: C15H15NO2S; Name: Acetamide, 2-[(diphenylmethyl)sulfinyl]-)

* 106392-12-5 (Formula: (C3H6O.C2H4O)x; Name: Oxirane, methyl-, polymer with oxirane, block)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
CS_gas_(data_page) (2346)
```
Botcommand: addindex 360573315 CS_gas_(data_page)
```
```
For index : CS_gas_(data_page)=360573315
```
* 2698-41-1 -> 2698-41-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CS+gas+data+page not found on commonchemistry - CS+gas+data+page

* ChemSpiderID: 16644 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C10H5ClN2/c11-10-4-2-1-3-9(10)5-8(6-12)7-13/h1-5H - (ChemSpider: | InChI=InChI=1/C10H5ClN2/c11-10-4-2-1-3-9(10)5-8(6-12)7-13/h1-5H )

* SMILES: Clc1ccccc1\C=C(/C#N)C#N - (ChemSpider: | SMILES=Clc1ccccc1\C=C(/C#N)C#N )
CTN-986 (2347)
```
Botcommand: addindex 350556246 CTN-986
```
```
For index : CTN-986=350556246
```
* 63947-67-1 -> 63947-67-1 - NOT VERIFIED

* CAS not found on commonchemistry

* CTN not found on commonchemistry - CTN

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: OC1=CC(O)=C(C(C(O[C@H]2[C@H](O[C@@]3([H])[C@H](O)[C@@](O)(CO)CO3)[C@@H](O)[C@H](O)[C@@H](CO[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4)O2)=C(C5=CC=C(O)C(O)=C5)O6)=O)C6=C1
CX-516 (2348)
```
Botcommand: addindex 346373851 CX-516
```
```
For index : CX-516=346373851
```
* 154235-83-3 -> 154235-83-3 - NOT VERIFIED

* CAS not found on commonchemistry

* CX found on commonchemistry - CX
* 121-82-4 (Formula: C3H6N6O6; Name: 1,3,5-Triazine, hexahydro-1,3,5-trinitro-)

* 128-37-0 (Formula: C15H24O; Name: Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl-)

* 471-34-1 (Formula: CH2O3.Ca; Name: Carbonic acid calcium salt (1:1))

* 1327-33-9 (Formula: Unspecified; Name: Antimony oxide)

* 1333-86-4 (Formula: Unspecified; Name: Carbon black)

* 3734-33-6 (Formula: C21H29N2O.C7H5O2; Name: Benzenemethanaminium, N-[2-[(2,6-dimethylphenyl)amino]-2-oxoethyl]-N,N-diethyl-, benzoate)

* 5466-77-3 (Formula: C18H26O3; Name: 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester)

* 7440-44-0 (Formula: C; Name: Carbon)

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 7782-42-5 (Formula: C; Name: Graphite)

* ChemSpiderID: 130635 (correct: 130635) - CORRECT - Retrieved data from ChemSpider

* PubChem: 148184

* No InChI - (ChemSpider: | InChI=InChI=1/C14H15N3O/c18-14(17-8-2-1-3-9-17)11-4-5-12-13(10-11)16-7-6-15-12/h4-7,10H,1-3,8-9H2 )

* No SMILES - (ChemSpider: | smiles=O=C(c2cc1nccnc1cc2)N3CCCCC3 )
CX-546 (2349)
```
Botcommand: addindex 348156900 CX-546
```
```
For index : CX-546=348156900
```
* 215923-54-9 -> 215923-54-9 - NOT VERIFIED

* CAS not found on commonchemistry

* CX found on commonchemistry - CX
* 121-82-4 (Formula: C3H6N6O6; Name: 1,3,5-Triazine, hexahydro-1,3,5-trinitro-)

* 128-37-0 (Formula: C15H24O; Name: Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl-)

* 471-34-1 (Formula: CH2O3.Ca; Name: Carbonic acid calcium salt (1:1))

* 1327-33-9 (Formula: Unspecified; Name: Antimony oxide)

* 1333-86-4 (Formula: Unspecified; Name: Carbon black)

* 3734-33-6 (Formula: C21H29N2O.C7H5O2; Name: Benzenemethanaminium, N-[2-[(2,6-dimethylphenyl)amino]-2-oxoethyl]-N,N-diethyl-, benzoate)

* 5466-77-3 (Formula: C18H26O3; Name: 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester)

* 7440-44-0 (Formula: C; Name: Carbon)

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 7782-42-5 (Formula: C; Name: Graphite)

* No ChemSpiderID

* PubChem: 2890

* No InChI

* No SMILES
CX614 (2350)
```
Botcommand: addindex 355706460 CX614
```
```
For index : CX614=355706460
```
* 191744-13-5 -> 191744-13-5 - NOT VERIFIED

* CAS not found on commonchemistry

* CX found on commonchemistry - CX
* 121-82-4 (Formula: C3H6N6O6; Name: 1,3,5-Triazine, hexahydro-1,3,5-trinitro-)

* 128-37-0 (Formula: C15H24O; Name: Phenol, 2,6-bis(1,1-dimethylethyl)-4-methyl-)

* 471-34-1 (Formula: CH2O3.Ca; Name: Carbonic acid calcium salt (1:1))

* 1327-33-9 (Formula: Unspecified; Name: Antimony oxide)

* 1333-86-4 (Formula: Unspecified; Name: Carbon black)

* 3734-33-6 (Formula: C21H29N2O.C7H5O2; Name: Benzenemethanaminium, N-[2-[(2,6-dimethylphenyl)amino]-2-oxoethyl]-N,N-diethyl-, benzoate)

* 5466-77-3 (Formula: C18H26O3; Name: 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester)

* 7440-44-0 (Formula: C; Name: Carbon)

* 7631-86-9 (Formula: O2Si; Name: Silica)

* 7782-42-5 (Formula: C; Name: Graphite)

* No ChemSpiderID

* PubChem: 6451148

* No InChI

* No SMILES

2351 to 2400

CYP-LAD (2351)

* No CASNo

* CYP+LAD not found on commonchemistry - CYP+LAD

* ChemSpiderID: 21106273 (correct: 21106273) - CORRECT - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/C22H27N3O/c1-3-24(4-2)22(26)15-10-18-17-6-5-7-19-21(17)14(12-23-19)11-20(18)25(13-15)16-8-9-16/h5-7,10,12,15-16,20,23H,3-4,8-9,11,13H2,1-2H3/t15-,20-/m1/s1 )

* No SMILES - (ChemSpider: | smiles=CCN(CC)C(=O)[C@@H]2/C=C1/c4cccc5ncc(C[C@H]1N(C2)C3CC3)c45 )
CYT006-AngQb (2352)
* No CASNo

* CYT+AngQb not found on commonchemistry - CYT+AngQb

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cacodyl (2354)
```
Botcommand: addindex 340116265 Cacodyl
```
```
For index : Cacodyl=340116265
```
* 471-35-2 -> 471-35-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Cacodyl found on commonchemistry - Cacodyl
* 75-60-5 (Formula: C2H7AsO2; Name: Arsinic acid, dimethyl-)

* 124-65-2 (Formula: C2H7AsO2.Na; Name: Arsinic acid, dimethyl-, sodium salt)

* ChemSpiderID: 71351 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 79018

* InChI: 1/C4H12As2/c1-5(2)6(3)4/h1-4H3 - (ChemSpider: | InChI=InChI=1/C4H12As2/c1-5(2)6(3)4/h1-4H3 )

* SMILES: [As]([As](C)C)(C)C - (ChemSpider: | SMILES=[As]([As](C)C)(C)C )
Cacodyl_oxide (2355)
```
Botcommand: addindex 306111200 Cacodyl_oxide
```
```
For index : Cacodyl_oxide=306111200
```
* 503-80-0 -> 503-80-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cacodyl+oxide not found on commonchemistry - Cacodyl+oxide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C[As](C)O[As](C)C
Cacotheline (2357)
```
Botcommand: addindex 338557949 Cacotheline
```
```
For index : Cacotheline=338557949
```
* 561-20-6 -> 561-20-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Cacotheline not found on commonchemistry - Cacotheline

* ChemSpiderID: 61696 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6841

* InChI: 1/C21H21N3O7/c25-12-6-11-17(18(19(12)28)24(29)30)22-20-16-10-5-14-21(11,20)2-3-23(14)8-9(10)1-4-31-13(16)7-15(26)27/h1,6,10,13-14,16,20,22H,2-5,7-8H2,(H,26,27)/t10-,13-,14-,16-,20-,21+/m0/s1 - (ChemSpider: | InChI=InChI=1/C21H21N3O7/c25-12-6-11-17(18(19(12)28)24(29)30)22-20-16-10-5-14-21(11,20)2-3-23(14)8-9(10)1-4-31-13(16)7-15(26)27/h1,6,10,13-14,16,20,22H,2-5,7-8H2,(H,26,27)/t10-,13-,14-,16-,20-,21+/m0/s1 )

* SMILES: [O-][N+](=O)C=1C(=O)C(=O)/C=C3\C=1N[C@H]4[C@H]2[C@@H]6/C(=C\CO[C@H]2CC(=O)O)CN5CC[C@]34[C@@H]5C6 - (ChemSpider: | SMILES=[O-][N+](=O)C=1C(=O)C(=O)/C=C3\C=1N[C@H]4[C@H]2[C@@H]6/C(=C\CO[C@H]2CC(=O)O)CN5CC[C@]34[C@@H]5C6 )
Cadalene (2358)
```
Botcommand: addindex 354051976 Cadalene
```
```
For index : Cadalene=354051976
```
* 483-78-3 -> 483-78-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadalene not found on commonchemistry - Cadalene

* ChemSpiderID: 9808 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 10225

* InChI: 1/C15H18/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5-10H,1-4H3 - (ChemSpider: | InChI=InChI=1/C15H18/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5-10H,1-4H3 )

* SMILES: c12c(ccc(c1ccc(c2)C)C)C(C)C - (ChemSpider: | SMILES=c12c(ccc(c1ccc(c2)C)C)C(C)C )
Cadexomer_iodine (2360)
```
Botcommand: addindex 363785748 Cadexomer_iodine
```
```
For index : Cadexomer_iodine=363785748
```
* 94820-09-4 -> 94820-09-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadexomer+iodine not found on commonchemistry - Cadexomer+iodine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cadinene (2361)

* No CASNo

* Cadinene found on commonchemistry - Cadinene
* 483-76-1 (Formula: C15H24; Name: Naphthalene, 1,2,3,5,6,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)-, (1S,8aR)-)

* 10208-80-7 (Formula: C15H24; Name: Naphthalene, 1,2,4a,5,6,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)-, (1S,4aS,8aR)-)

* No ChemSpiderID (correct: 4937651)

* No PubChem

* No InChI

* No SMILES
Cadmium_arsenide (2363)
```
Botcommand: addindex 338735908 Cadmium_arsenide
```
```
For index : Cadmium_arsenide=338735908
```
* 12006-15-4 -> 12006-15-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadmium+arsenide not found on commonchemistry - Cadmium+arsenide

* ChemSpiderID: 10678197 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/2As.3Cd/q2*-3;3*+2 - (ChemSpider: | InChI=InChI=1/2As.3Cd/q2*-3;3*+2 )

* SMILES: [Cd+2].[Cd+2].[Cd+2].[AsH6-3].[AsH6-3] - (ChemSpider: | SMILES=[Cd+2].[Cd+2].[Cd+2].[AsH6-3].[AsH6-3] )
Cadmium_cyanide (2366)
```
Botcommand: addindex 356059935 Cadmium_cyanide
```
```
For index : Cadmium_cyanide=356059935
```
* 542-83-6 -> 542-83-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadmium+cyanide not found on commonchemistry - Cadmium+cyanide

* ChemSpiderID: 61630 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 68335

* InChI: 1/2CN.Cd/c2*1-2;/q2*-1;+2 - (ChemSpider: | InChI=InChI=1/2CN.Cd/c2*1-2;/q2*-1;+2 )

* SMILES: [Cd+2].[C-]#N.[C-]#N - (ChemSpider: | SMILES=[Cd+2].[C-]#N.[C-]#N )
Cadmium_tungstate (2376)
```
Botcommand: addindex 291511140 Cadmium_tungstate
```
```
For index : Cadmium_tungstate=291511140
```
* 7790-85-4 -> 7790-85-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadmium+tungstate not found on commonchemistry - Cadmium+tungstate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cadmium(I)_tetrachloroaluminate (2377)
```
Botcommand: addindex 298453186 Cadmium(I)_tetrachloroaluminate
```
```
For index : Cadmium(I)_tetrachloroaluminate=298453186
```
* 79110-87-5 -> 79110-87-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadmium+I+tetrachloroaluminate not found on commonchemistry - Cadmium+I+tetrachloroaluminate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cadralazine (2378)
```
Botcommand: addindex 353871711 Cadralazine
```
```
For index : Cadralazine=353871711
```
* 64241-34-5 -> 64241-34-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Cadralazine not found on commonchemistry - Cadralazine

* No ChemSpiderID

* PubChem: 2515

* No InChI

* No SMILES
Caduet (2379)

* No CASNo

* Caduet not found on commonchemistry - Caduet

* ChemSpiderID: 7987512 (correct: 7987512) - CORRECT - Retrieved data from ChemSpider

* PubChem: 9811759

* No InChI - (ChemSpider: | InChI=InChI=1/C33H35FN2O5.C20H25ClN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);5-8,17,23H,4,9-11,22H2,1-3H3/t26-,27-;/m1./s1 )

* No SMILES - (ChemSpider: | smiles=Clc1ccccc1C2C(\C(=O)OC)=C(/N\C(=C2\C(=O)OCC)COCCN)C.O=C(O)C[C@H](O)C[C@H](O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C )
Caesium_cadmium_bromide (2382)
File:Cscdbr3.jpg

* No CASNo

* Caesium+cadmium+bromide not found on commonchemistry - Caesium+cadmium+bromide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Caesium_cadmium_chloride (2383)
* No CASNo

* Caesium+cadmium+chloride not found on commonchemistry - Caesium+cadmium+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Caesium_chromate (2386)
```
Botcommand: addindex 362144016 Caesium_chromate
```
```
For index : Caesium_chromate=362144016
```
* 13454-78-9 -> 13454-78-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Caesium+chromate not found on commonchemistry - Caesium+chromate

* ChemSpiderID: 55521 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 61613

* InChI: 1/Cr.2Cs.4O/q;2*+1;;;2*-1/rCrO4.2Cs/c2-1(3,4)5;;/q-2;2*+1 - (ChemSpider: | InChI=InChI=1/Cr.2Cs.4O/q;2*+1;;;2*-1/rCrO4.2Cs/c2-1(3,4)5;;/q-2;2*+1 )

* SMILES: [Cs+].[Cs+].[O-][Cr]([O-])(=O)=O - (ChemSpider: | SMILES=[Cs+].[Cs+].[O-][Cr]([O-])(=O)=O )
Caesium_dodecaborate (2387)

* No CASNo

* Caesium+dodecaborate not found on commonchemistry - Caesium+dodecaborate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Caesium_hydride (2389)
```
Botcommand: addindex 363540713 Caesium_hydride
```
```
For index : Caesium_hydride=363540713
```
* 13772-47-9 -> 13772-47-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Caesium+hydride not found on commonchemistry - Caesium+hydride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Caesium_lithium_borate (2392)
* No CASNo

* Caesium+lithium+borate not found on commonchemistry - Caesium+lithium+borate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cafaminol (2397)
```
Botcommand: addindex 355100027 Cafaminol
```
```
For index : Cafaminol=355100027
```
* 30924-31-3 -> 30924-31-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Cafaminol not found on commonchemistry - Cafaminol

* ChemSpiderID: 32824 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 35685

* No InChI - (ChemSpider: | InChI=InChI=1/C11H17N5O3/c1-13(5-6-17)10-12-8-7(14(10)2)9(18)16(4)11(19)15(8)3/h17H,5-6H2,1-4H3 )

* No SMILES - (ChemSpider: | smiles=O=C2N(c1nc(n(c1C(=O)N2C)C)N(CCO)C)C )
Cafedrine (2398)
```
Botcommand: addindex 339145356 Cafedrine
```
```
For index : Cafedrine=339145356
```
* 58166-83-9 -> 58166-83-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Cafedrine not found on commonchemistry - Cafedrine

* ChemSpiderID: 64784 (correct: 4590188) - INCORRECT

* PubChem: 71740

* No InChI

* No SMILES
Cafestol (2399)
```
Botcommand: addindex 358213875 Cafestol
```
```
For index : Cafestol=358213875
```
* 469-83-0 -> 469-83-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Cafestol not found on commonchemistry - Cafestol

* ChemSpiderID: 10289419 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 108052

* No InChI - (ChemSpider: | InChI=InChI=1/C20H28O3/c1-18-7-5-16-14(6-9-23-16)15(18)4-8-19-10-13(2-3-17(18)19)20(22,11-19)12-21/h6,9,13,15,17,21-22H,2-5,7-8,10-12H2,1H3/t13?,15-,17+,18-,19+,20+/m1/s1 )

* No SMILES - (ChemSpider: | smiles=OC[C@@]5(O)C[C@@]31C[C@@H]5CC[C@H]1[C@]4(C)CCc2occc2[C@H]4CC3 )

2401 to 2450

Caffeine_citrate (2402)
```
Botcommand: addindex 347993377 Caffeine_citrate
```
```
For index : Caffeine_citrate=347993377
```
* 69-22-7 -> 69-22-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Caffeine+citrate not found on commonchemistry - Caffeine+citrate

* No ChemSpiderID

* PubChem: 6241

* No InChI

* No SMILES
Caffeyl_alcohol (2403)
```
Botcommand: addindex 349024042 Caffeyl_alcohol
```
```
For index : Caffeyl_alcohol=349024042
```
* 3598-26-3 -> 3598-26-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Caffeyl+alcohol not found on commonchemistry - Caffeyl+alcohol

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Caftaric_acid (2404)

* No CASNo

* Caftaric+acid not found on commonchemistry - Caftaric+acid

* ChemSpiderID: 4944664 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6440397

* No InChI - (ChemSpider: | InChI=InChI=1/C13H12O9/c14-7-3-1-6(5-8(7)15)2-4-9(16)22-11(13(20)21)10(17)12(18)19/h1-5,10-11,14-15,17H,(H,18,19)(H,20,21)/b4-2+/t10-,11-/m1/s1 )

* SMILES: O=C(O)[C@H](O)[C@@H](OC(=O)\C=C\c1cc(O)c(O)cc1)C(=O)O - (ChemSpider: | SMILES=O=C(O)[C@H](O)[C@@H](OC(=O)\C=C\c1cc(O)c(O)cc1)C(=O)O )
Calanolide_A (2405)
```
Botcommand: addindex 339145710 Calanolide_A
```
```
For index : Calanolide_A=339145710
```
* 142632-32-4 -> 142632-32-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Calanolide+A not found on commonchemistry - Calanolide+A

* ChemSpiderID: 58497 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 64972

* No InChI - (ChemSpider: | InChI=InChI=1/C22H26O5/c1-6-7-13-10-15(23)26-21-16(13)20-14(8-9-22(4,5)27-20)19-17(21)18(24)11(2)12(3)25-19/h8-12,18,24H,6-7H2,1-5H3/t11-,12-,18+/m1/s1 )

* No SMILES - (ChemSpider: | smiles=O=C/4Oc2c(c3OC(/C=C\c3c1O[C@@H]([C@@H](C)[C@H](O)c12)C)(C)C)\C(=C\4)CCC )
Calcein (2406)
```
Botcommand: addindex 357956117 Calcein
```
```
For index : Calcein=357956117
```
* 1461-15-0 -> 1461-15-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcein not found on commonchemistry - Calcein

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(O5)c1ccccc1C (c3cc(CN(CC(O)=O) CC(O)=O)c(O)cc3O4) 5c2c4cc(O)c(CN(CC (O)=O)CC(O)=O)c2
Calcitroic_acid (2409)
```
Botcommand: addindex 359309717 Calcitroic_acid
```
```
For index : Calcitroic_acid=359309717
```
* 71204-89-2 -> 71204-89-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcitroic+acid not found on commonchemistry - Calcitroic+acid

* ChemSpiderID: 4947800 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6443842

* InChI: 1/C23H34O4/c1-14(11-22(26)27)19-8-9-20-16(5-4-10-23(19,20)3)6-7-17-12-18(24)13-21(25)15(17)2/h6-7,14,18-21,24-25H,2,4-5,8-13H2,1,3H3,(H,26,27)/b16-6+,17-7-/t14-,18+,19-,20+,21-,23-/m1/s1 - (ChemSpider: | InChI=InChI=1/C23H34O4/c1-14(11-22(26)27)19-8-9-20-16(5-4-10-23(19,20)3)6-7-17-12-18(24)13-21(25)15(17)2/h6-7,14,18-21,24-25H,2,4-5,8-13H2,1,3H3,(H,26,27)/b16-6+,17-7-/t14-,18+,19-,20+,21-,23-/m1/s1 )

* SMILES: O=C(O)C[C@@H](C)[C@H]3CC[C@H]2C(=C\C=C1/C(=C)[C@H](O)C[C@@H](O)C1)\CCC[C@@]23C - (ChemSpider: | SMILES=O=C(O)C[C@@H](C)[C@H]3CC[C@H]2C(=C\C=C1/C(=C)[C@H](O)C[C@@H](O)C1)\CCC[C@@]23C )
Calcium_2-aminoethylphosphate (2410)
```
Botcommand: addindex 275431878 Calcium_2-aminoethylphosphate
```
```
For index : Calcium_2-aminoethylphosphate=275431878
```
* 10389-08-9 -> 10389-08-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+aminoethylphosphate not found on commonchemistry - Calcium+aminoethylphosphate

* No ChemSpiderID

* PubChem: 19985431

* No InChI

* SMILES: C(COP(=O)([O-])[O-])N.[Ca+2]
Calcium_acetate/magnesium_carbonate (2412)
```
Botcommand: addindex 357380918 Calcium_acetate/magnesium_carbonate
```
```
For index : Calcium_acetate/magnesium_carbonate=357380918
```
* 62-54-4 -> 62-54-4 - NOT VERIFIED

* CAS found on commonchemistry - 62-54-4 - name not in list
All names: ACETATE, CALCIUM, Acetic acid, calcium salt, Acetic acid, calcium salt (2:1), Brown acetate, Calcium acetate, calcium di(acetate), Calcium diacetate, CALCIUMACETAT, Calciumdi(acetat), Di(acetate) de calcium, di(acetato) de calcio, E 263, Gray acetate, Lime acetate, Lime pyrolignite, PhosLo, Royen, Sanopan, Sorbo-Calcion, Teltozan

* Calcium+acetate+magnesium+carbonate not found on commonchemistry - Calcium+acetate+magnesium+carbonate

* No ChemSpiderID

* PubChem: 11029

* No InChI

* No SMILES
Calcium_arsenate (2413)
```
Botcommand: addindex 364206105 Calcium_arsenate
```
```
For index : Calcium_arsenate=364206105
```
* 7778-44-1 -> 7778-44-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+arsenate not found on commonchemistry - Calcium+arsenate

* No ChemSpiderID

* PubChem: 24501

* No InChI

* No SMILES
Calcium_ascorbate (2414)
```
Botcommand: addindex 353688157 Calcium_ascorbate
```
```
For index : Calcium_ascorbate=353688157
```
* 5743-27-1 -> 5743-27-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+ascorbate not found on commonchemistry - Calcium+ascorbate

* ChemSpiderID: 4445637 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 21967

* InChI: 1/2C6H8O6.Ca.2H2O/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;;;/h2*2,5,7-8,10-11H,1H2;;2*1H2/q;;+2;;/p-2/t2*2-,5+;;;/m00.../s1 - (ChemSpider: | InChI=InChI=1/2C6H8O6.Ca.2H2O/c2*7-1-2(8)5-3(9)4(10)6(11)12-5;;;/h2*2,5,7-8,10-11H,1H2;;2*1H2/q;;+2;;/p-2/t2*2-,5+;;;/m00.../s1 )

* SMILES: [Ca+2].O=C1C(\O)=C(\[O-])O[C@@H]1[C@@H](O)CO.O=C1C(\O)=C(\[O-])O[C@@H]1[C@@H](O)CO.O.O - (ChemSpider: | SMILES=[Ca+2].O=C1C(\O)=C(\[O-])O[C@@H]1[C@@H](O)CO.O=C1C(\O)=C(\[O-])O[C@@H]1[C@@H](O)CO.O.O )
Calcium_benzoate (2415)
```
Botcommand: addindex 339147845 Calcium_benzoate
```
```
For index : Calcium_benzoate=339147845
```
* 2090-05-3 -> 2090-05-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+benzoate not found on commonchemistry - Calcium+benzoate

* ChemSpiderID: 56210 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 62425

* InChI: 1/2C7H6O2.Ca/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 - (ChemSpider: | InChI=InChI=1/2C7H6O2.Ca/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 )

* SMILES: [Ca+2].[O-]C(=O)c1ccccc1.[O-]C(=O)c1ccccc1 - (ChemSpider: | SMILES=[Ca+2].[O-]C(=O)c1ccccc1.[O-]C(=O)c1ccccc1 )
Calcium_beta-hydroxy-beta-methylbutyrate (2416)
```
Botcommand: addindex 362900583 Calcium_beta-hydroxy-beta-methylbutyrate
```
```
For index : Calcium_beta-hydroxy-beta-methylbutyrate=362900583
```
* 135236-72-5 -> 135236-72-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+beta+hydroxy+beta+methylbutyrate not found on commonchemistry - Calcium+beta+hydroxy+beta+methylbutyrate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_bicarbonate (2417)
* No CASNo

* Calcium+bicarbonate not found on commonchemistry - Calcium+bicarbonate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_bisulfite (2418)
```
Botcommand: addindex 356048550 Calcium_bisulfite
```
```
For index : Calcium_bisulfite=356048550
```
* 13780-03-5 -> 13780-03-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+bisulfite not found on commonchemistry - Calcium+bisulfite

* No ChemSpiderID

* PubChem: 26268

* No InChI

* SMILES: OS(=O)[O-].OS(=O)[O-].[Ca+2]
Calcium_borate (2419)
```
Botcommand: addindex 363439113 Calcium_borate
```
```
For index : Calcium_borate=363439113
```
* 12007-56-6 -> 12007-56-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+borate not found on commonchemistry - Calcium+borate

* ChemSpiderID: 11253569 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/4BO3.6Ca/c4*2-1(3)4;;;;;;/q4*-3;6*+2 - (ChemSpider: | InChI=InChI=1/4BO3.6Ca/c4*2-1(3)4;;;;;;/q4*-3;6*+2 )

* SMILES: [Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-] - (ChemSpider: | SMILES=[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-] )
Calcium_bromate (2420)
```
Botcommand: addindex 356049026 Calcium_bromate
```
```
For index : Calcium_bromate=356049026
```
* 10102-75-7 -> 10102-75-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+bromate not found on commonchemistry - Calcium+bromate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_carbimide (2423)
```
Botcommand: addindex 346888728 Calcium_carbimide
```
```
For index : Calcium_carbimide=346888728
```
* 8013-88-5 -> 8013-88-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+carbimide found on commonchemistry - Calcium+carbimide
* 156-62-7 (exact match)
Name in list

All names: Alzodef, [[calcium carbimide]], calcium cyanamide, Calcium cyanamide (CaCN2), Calciumcyanamid, CCC, cianamida calcica, con un contenido en nitrogeno superior al 25 por ciento, calculado sobre el producto anhidro y en estado seco, Cyanamid, Cyanamide calcique, CYANAMIDE, CALCIUM, Cyanamide, calcium salt (1:1), Cy-L 500, Dormex, Lime nitrogen, Nitrogen lime, Nitrolim, Nitrolime, Perlka, UN 1403

* No ChemSpiderID

* PubChem: 6335910

* No InChI

* No SMILES
Calcium_chlorate (2425)
```
Botcommand: addindex 361908419 Calcium_chlorate
```
```
For index : Calcium_chlorate=361908419
```
* 10017-74-3 -> 10017-74-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+chlorate found on commonchemistry - Calcium+chlorate
* 10137-74-3 (exact match)
Name in list

All names: [[calcium chlorate]], [[calcium chlorate (Ca(ClO3)2)]], Calciumchlorat, chlorate de calcium, Chloric acid, calcium salt, Chloric acid, calcium salt (2:1), clorato de calcio, UN 1452, UN 2429

* No ChemSpiderID

* PubChem: 24978

* No InChI

* No SMILES
Calcium_chromate (2427)
```
Botcommand: addindex 361955272 Calcium_chromate
```
```
For index : Calcium_chromate=361955272
```
* 13765-19-0 -> 13765-19-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+chromate not found on commonchemistry - Calcium+chromate

* No ChemSpiderID

* PubChem: 26264

* No InChI

* No SMILES
Calcium_citrate (2428)
```
Botcommand: addindex 355595613 Calcium_citrate
```
```
For index : Calcium_citrate=355595613
```
* 813-94-5 -> 813-94-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+citrate found on commonchemistry - Calcium+citrate
* 7693-13-2 (exact match)
Name in list

All names: 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, calcium salt, 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, calcium salt (1:?), Acide citrique, sel de calcium, acido citrico, sal de calcio, [[calcium citrate]], Citramar, CITRATE, CALCIUM, Citric acid calcium salt, citric acid, calcium salt, E 333, Zitronensaure, Calciumsalz

* ChemSpiderID: 12584 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/2C6H8O7.3Ca/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;;3*+2/p-6 - (ChemSpider: | InChI=InChI=1/2C6H8O7.3Ca/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;;3*+2/p-6 )

* SMILES: [Ca+2].[Ca+2].[Ca+2].O=C([O-])CC(O)(C([O-])=O)CC(=O)[O-].[O-]C(=O)C(O)(CC([O-])=O)CC([O-])=O - (ChemSpider: | SMILES=[Ca+2].[Ca+2].[Ca+2].O=C([O-])CC(O)(C([O-])=O)CC(=O)[O-].[O-]C(=O)C(O)(CC([O-])=O)CC([O-])=O )
Calcium_citrate_malate (2429)
```
Botcommand: addindex 355602966 Calcium_citrate_malate
```
```
For index : Calcium_citrate_malate=355602966
```
* 142606-53-9 -> 142606-53-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+citrate+malate not found on commonchemistry - Calcium+citrate+malate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_diglutamate (2431)
```
Botcommand: addindex 339148122 Calcium_diglutamate
```
```
For index : Calcium_diglutamate=339148122
```
* 5996-22-5 -> 5996-22-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+diglutamate not found on commonchemistry - Calcium+diglutamate

* ChemSpiderID: 21172248 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/2C5H9NO4.Ca.2H/c2*6-3(5(9)10)1-2-4(7)8;;;/h2*3H,1-2,6H2,(H,7,8)(H,9,10);;;/p-4/t2*3-;;;/m00.../s1/r2C5H9NO4.CaH2/c2*6-3(5(9)10)1-2-4(7)8;/h2*3H,1-2,6H2,(H,7,8)(H,9,10);1H2/p-4/t2*3-;/m00./s1 - (ChemSpider: | InChI=InChI=1/2C5H9NO4.Ca.2H/c2*6-3(5(9)10)1-2-4(7)8;;;/h2*3H,1-2,6H2,(H,7,8)(H,9,10);;;/p-4/t2*3-;;;/m00.../s1/r2C5H9NO4.CaH2/c2*6-3(5(9)10)1-2-4(7)8;/h2*3H,1-2,6H2,(H,7,8)(H,9,10);1H2/p-4/t2*3-;/m00./s1 )

* SMILES: C(CC(=O)[O-])C(C(=O)[O-])N.C(CC(=O)[O-])C(C(=O)[O-])N.[CaH2] - (ChemSpider: | SMILES=C(CC(=O)[O-])C(C(=O)[O-])N.C(CC(=O)[O-])C(C(=O)[O-])N.[CaH2] )
Calcium_dobesilate (2432)

* No CASNo

* Calcium+dobesilate not found on commonchemistry - Calcium+dobesilate

* No ChemSpiderID

* PubChem: 29963

* No InChI

* No SMILES
Calcium_glubionate (2435)

* No CASNo

* Calcium+glubionate not found on commonchemistry - Calcium+glubionate

* No ChemSpiderID

* PubChem: 64776

* No InChI

* No SMILES
Calcium_glucoheptonate (2436)

* No CASNo

* Calcium+glucoheptonate found on commonchemistry - Calcium+glucoheptonate
* 29039-00-7 (exact match)
Name in list

All names: [[bis[(2Î¾)-D-GLUCO-heptonate] de calcium]], [[bis[(2Î¾)-D-gluco-heptonato] de calcio]], Calcihept, [[calcium bis[(2Î¾)-D-GLUCO-heptonate]]], Calcium gluceptate, [[calcium glucoheptonate]], Calcium heptagluconate, [[Calciumbis[(2Î¾)-D-GLUCO-heptonat]]], D-gluco-Heptonic acid, calcium salt (2:1), (2Î¾)-, Glucoheptonic acid, calcium salt (2:1)

* No ChemSpiderID

* PubChem: 28327

* No InChI

* No SMILES
Calcium_glycerylphosphate (2438)

* No CASNo

* Calcium+glycerylphosphate not found on commonchemistry - Calcium+glycerylphosphate

* No ChemSpiderID

* PubChem: 62820

* No InChI

* No SMILES
Calcium_guanylate (2439)
```
Botcommand: addindex 346348772 Calcium_guanylate
```
```
For index : Calcium_guanylate=346348772
```
* 38966-30-2 -> 38966-30-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+guanylate not found on commonchemistry - Calcium+guanylate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O[C@H]1[C@@H](O)[C@H](N2C=NC3=C2NC(N)=NC3=O)O[C@@H]1COP([O-])([O-])=O.[Ca+2]
Calcium_hexaboride (2440)
```
Botcommand: addindex 362971787 Calcium_hexaboride
```
```
For index : Calcium_hexaboride=362971787
```
* 12007-99-7 -> 12007-99-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+hexaboride not found on commonchemistry - Calcium+hexaboride

* No ChemSpiderID

* PubChem: 16212529

* No InChI

* No SMILES
Calcium_hexamine_thiocyanate (2441)
* No CASNo

* Calcium+hexamine+thiocyanate not found on commonchemistry - Calcium+hexamine+thiocyanate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_inosinate (2445)
```
Botcommand: addindex 299631039 Calcium_inosinate
```
```
For index : Calcium_inosinate=299631039
```
* 38966-29-9 -> 38966-29-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+inosinate not found on commonchemistry - Calcium+inosinate

* No ChemSpiderID

* PubChem: 8582 (without Calcium)

* No InChI

* SMILES: [O-]P(OC[C@H]1O[C@@H](N2C(NC=NC3=O)=C3N=C2)[C@H](O)[C@@H]1O)([O-])=O.[Ca+2]
Calcium_lactate_gluconate (2449)
```
Botcommand: addindex 349562127 Calcium_lactate_gluconate
```
```
For index : Calcium_lactate_gluconate=349562127
```
* 11116-97-5 -> 11116-97-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+lactate+gluconate not found on commonchemistry - Calcium+lactate+gluconate

* ChemSpiderID: 83274 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 92237

* InChI: 1/C6H12O7.C3H6O3.Ca/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2(4)3(5)6;/h2-5,7-11H,1H2,(H,12,13);2,4H,1H3,(H,5,6);/q;;+2/p-2/t2-,3-,4+,5-;;/m1../s1 - (ChemSpider: | InChI=InChI=1/C6H12O7.C3H6O3.Ca/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2(4)3(5)6;/h2-5,7-11H,1H2,(H,12,13);2,4H,1H3,(H,5,6);/q;;+2/p-2/t2-,3-,4+,5-;;/m1../s1 )

* SMILES: [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO - (ChemSpider: | SMILES=[Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO )
Calcium_malate (2450)
```
Botcommand: addindex 339156567 Calcium_malate
```
```
For index : Calcium_malate=339156567
```
* 17482-42-7 -> 17482-42-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+malate not found on commonchemistry - Calcium+malate

* ChemSpiderID: 146673 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 167659

* InChI: 1/C4H6O5.Ca/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 - (ChemSpider: | InChI=InChI=1/C4H6O5.Ca/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 )

* SMILES: [Ca+2].[O-]C(=O)CC(O)C([O-])=O - (ChemSpider: | SMILES=[Ca+2].[O-]C(=O)CC(O)C([O-])=O )

2451 to 2500

Calcium_monophosphide (2451)
```
Botcommand: addindex 328031093 Calcium_monophosphide
```
```
For index : Calcium_monophosphide=328031093
```
* 39373-03-0 -> 39373-03-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+monophosphide not found on commonchemistry - Calcium+monophosphide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_nitride (2453)
```
Botcommand: addindex 335839736 Calcium_nitride
```
```
For index : Calcium_nitride=335839736
```
* 12013-82-0 -> 12013-82-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+nitride not found on commonchemistry - Calcium+nitride

* No ChemSpiderID

* PubChem: 3387080

* No InChI

* No SMILES
Calcium_oxalate (2454)
```
Botcommand: addindex 362156146 Calcium_oxalate
```
```
For index : Calcium_oxalate=362156146
```
* 25454-23-3 -> 25454-23-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+oxalate found on commonchemistry - Calcium+oxalate
* 563-72-4 (exact match)
Name in list

All names: [[calcium oxalate]], [[calcium oxalate (1:1)]], Calciumoxalat, Ethanedioic acid, calcium salt (1:1), Oxalate de calcium, OXALATE, CALCIUM, oxalato de calcio, Oxalic acid, calcium salt (1:1)

* No ChemSpiderID

* PubChem: 16212978

* No InChI

* No SMILES
Calcium_pangamate (2456)
```
Botcommand: addindex 171244639 Calcium_pangamate
```
```
For index : Calcium_pangamate=171244639
```
* 11041-98-8 -> 11041-98-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+pangamate not found on commonchemistry - Calcium+pangamate

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_permanganate (2457)
```
Botcommand: addindex 360832083 Calcium_permanganate
```
```
For index : Calcium_permanganate=360832083
```
* 10118-76-0 -> 10118-76-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+permanganate not found on commonchemistry - Calcium+permanganate

* No ChemSpiderID

* PubChem: 24959

* No InChI

* No SMILES
Calcium_phosphide (2459)
```
Botcommand: addindex 322705376 Calcium_phosphide
```
```
For index : Calcium_phosphide=322705376
```
* 1305-99-3 -> 1305-99-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+phosphide not found on commonchemistry - Calcium+phosphide

* No ChemSpiderID

* PubChem: 4337964

* No InChI

* No SMILES
Calcium_polystyrene_sulfonate (2460)
```
Botcommand: addindex 357380993 Calcium_polystyrene_sulfonate
```
```
For index : Calcium_polystyrene_sulfonate=357380993
```
* 37286-92-3 -> 37286-92-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+polystyrene+sulfonate not found on commonchemistry - Calcium+polystyrene+sulfonate

* No ChemSpiderID

* PubChem: 75905

* No InChI

* No SMILES
Calcium_propionate (2461)
```
Botcommand: addindex 348928640 Calcium_propionate
```
```
For index : Calcium_propionate=348928640
```
* 4075-81-4 -> 4075-81-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+propionate not found on commonchemistry - Calcium+propionate

* No ChemSpiderID

* PubChem: 19999

* No InChI

* SMILES: CCC(=O)[O-].CCC(=O)[O-].[Ca+2]
Calcium_silicide (2464)
```
Botcommand: addindex 337248522 Calcium_silicide
```
```
For index : Calcium_silicide=337248522
```
* 12013-56-8 -> 12013-56-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+silicide not found on commonchemistry - Calcium+silicide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calcium_sorbate (2465)
```
Botcommand: addindex 347563061 Calcium_sorbate
```
```
For index : Calcium_sorbate=347563061
```
* 7492-55-9 -> 7492-55-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+sorbate not found on commonchemistry - Calcium+sorbate

* ChemSpiderID: 4938651 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 6433506

* InChI: 1/2C6H8O2.Ca/c2*1-2-3-4-5-6(7)8;/h2*2-5H,1H3,(H,7,8);/q;;+2/p-2/b2*3-2+,5-4+; - (ChemSpider: | InChI=InChI=1/2C6H8O2.Ca/c2*1-2-3-4-5-6(7)8;/h2*2-5H,1H3,(H,7,8);/q;;+2/p-2/b2*3-2+,5-4+; )

* SMILES: [Ca+2].O=C([O-])\C=C\C=C\C.[O-]C(=O)\C=C\C=C\C - (ChemSpider: | SMILES=[Ca+2].O=C([O-])\C=C\C=C\C.[O-]C(=O)\C=C\C=C\C )
Calcium_tartrate (2470)
```
Botcommand: addindex 339158641 Calcium_tartrate
```
```
For index : Calcium_tartrate=339158641
```
* 3164-34-9 -> 3164-34-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Calcium+tartrate not found on commonchemistry - Calcium+tartrate

* ChemSpiderID: 10606089 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 - (ChemSpider: | InChI=InChI=1/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 )

* SMILES: [Ca+2].O=C([O-])C(O)C(O)C([O-])=O - (ChemSpider: | SMILES=[Ca+2].O=C([O-])C(O)C(O)C([O-])=O )
Calcium(I)_chloride (2472)
* No CASNo

* Calcium+I+chloride not found on commonchemistry - Calcium+I+chloride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Caldarchaeol (2473)
```
Botcommand: addindex 352783064 Caldarchaeol
```
```
For index : Caldarchaeol=352783064
```
* 99529-31-4 -> 99529-31-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Caldarchaeol not found on commonchemistry - Caldarchaeol

* No ChemSpiderID

* PubChem: 5771745

* No InChI

* SMILES: CC1CCCC(CCCC(CCOCC(OCCC(CCCC(CCCC(CCCC(CCC (CCCC(CCCC(CCCC(CCOCC(OCCC(CCCC(CCCC(CCCC(CCC (CCC1)C)C)C)C)C)CO)C)C)C)C)C)C)C)C)CO)C)C
Calendic_acid (2474)
```
Botcommand: addindex 265830081 Calendic_acid
```
```
For index : Calendic_acid=265830081
```
* 5204-87-5 -> 5204-87-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calendic+acid not found on commonchemistry - Calendic+acid

* No ChemSpiderID

* PubChem: 5282818

* No InChI

* SMILES: CCCCC\C=C/C=C/C=C/CCCCCCC(=O)O
Calicheamicin (2475)
```
Botcommand: addindex 339158793 Calicheamicin
```
```
For index : Calicheamicin=339158793
```
* 108212-75-5 -> 108212-75-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Calicheamicin not found on commonchemistry - Calicheamicin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Calligonine (2476)
```
Botcommand: addindex 325097049 Calligonine
```
```
For index : Calligonine=325097049
```
* 2254-36-6 -> 2254-36-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Calligonine not found on commonchemistry - Calligonine

* No ChemSpiderID

* PubChem: 442025

* No InChI

* SMILES: c13ccccc1nc2c3CCNC2C
Calmagite (2477)
```
Botcommand: addindex 339158866 Calmagite
```
```
For index : Calmagite=339158866
```
* 3147-14-6 -> 3147-14-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Calmagite not found on commonchemistry - Calmagite

* ChemSpiderID: 21159783 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5483111

* InChI: 1/C17H14N2O5S/c1-10-6-7-14(20)13(8-10)18-19-17-12-5-3-2-4-11(12)16(9-15(17)21)25(22,23)24/h2-9,20-21H,1H3,(H,22,23,24) - (ChemSpider: | InChI=InChI=1/C17H14N2O5S/c1-10-6-7-14(20)13(8-10)18-19-17-12-5-3-2-4-11(12)16(9-15(17)21)25(22,23)24/h2-9,20-21H,1H3,(H,22,23,24) )

* SMILES: Oc3ccc(C)cc3N=Nc2c1ccccc1c(cc2O)S(O)(=O)=O - (ChemSpider: | SMILES=Oc3ccc(C)cc3N=Nc2c1ccccc1c(cc2O)S(O)(=O)=O )
Calone (2478)
```
Botcommand: addindex 350017966 Calone
```
```
For index : Calone=350017966
```
* 28940-11-6 -> 28940-11-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Calone found on commonchemistry - Calone
* 106-02-5 (exact match)
Name in list

All names: 1,15-Pentadecanolide, 15-Hydroxypentadecanoic acid lactone, 15-Pentadecanolide, 15-Pentadodecanolactone, 1-Oxacyclohexadecan-2-one, [[2-Pentadecalone]], cpd Supra, CPE 215, Cyclopentadecanolide, Exaltolide, Muskalactone, NSC 36763, Oxacyclohexadecan-2-one, PENTADECALACTONE, Pentadecan-15-olid, Pentadecan-15-olide, pentadecan-15-olido, pentadecane-15-olide, Pentadecanoic acid, 15-hydroxy-, Î¾-lactone, Pentadecanolactone, Pentadecanolide, PENTALIDE, THIBETOLID, PENTADECANOLIDE-, Thibetolide, Ï‰-Pentadecalactone

* ChemSpiderID: 107218 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C10H10O3/c1-7-2-3-9-10(4-7)13-6-8(11)5-12-9/h2-4H,5-6H2,1H3 - (ChemSpider: | InChI=InChI=1/C10H10O3/c1-7-2-3-9-10(4-7)13-6-8(11)5-12-9/h2-4H,5-6H2,1H3 )

* SMILES: O=C1COc2c(OC1)cc(cc2)C - (ChemSpider: | SMILES=O=C1COc2c(OC1)cc(cc2)C )
Calphostin_C (2479)
```
Botcommand: addindex 346364943 Calphostin_C
```
```
For index : Calphostin_C=346364943
```
* 121263-19-2 -> 121263-19-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Calphostin+C not found on commonchemistry - Calphostin+C

* No ChemSpiderID

* PubChem: 10930781

* No InChI

* SMILES: C[C@H](CC1=C(C(=C2C(=O)C=C(C3=C4C(=CC(=O)C5=C(C(=C(C(=C45)C1=C32)C[C@@H](C)OC(=O)OC6=CC=C(C=C6)O)OC)O)OC)OC)O)OC)OC(=O)C7=CC=CC=C7
Calusterone (2480)
```
Botcommand: addindex 356724600 Calusterone
```
```
For index : Calusterone=356724600
```
* 17021-26-0 -> 17021-26-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Calusterone not found on commonchemistry - Calusterone

* ChemSpiderID: 26239 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 28204

* InChI: 1/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16-,17-,18+,19-,20-,21-/m0/s1 - (ChemSpider: | InChI=InChI=1/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16-,17-,18+,19-,20-,21-/m0/s1 )

* SMILES: O=C4\C=C3/[C@]([C@H]2CC[C@]1([C@@H](CC[C@@]1(O)C)[C@@H]2[C@@H](C)C3)C)(C)CC4 - (ChemSpider: | SMILES=O=C4\C=C3/[C@]([C@H]2CC[C@]1([C@@H](CC[C@@]1(O)C)[C@@H]2[C@@H](C)C3)C)(C)CC4 )
Calycosin (2481)
```
Botcommand: addindex 350356487 Calycosin
```
```
For index : Calycosin=350356487
```
* 20575-57-9 -> 20575-57-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Calycosin not found on commonchemistry - Calycosin

* No ChemSpiderID

* PubChem: 5280448

* No InChI

* SMILES: COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O
Camazepam (2482)
```
Botcommand: addindex 345305840 Camazepam
```
```
For index : Camazepam=345305840
```
* 36104-80-0 -> 36104-80-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Camazepam not found on commonchemistry - Camazepam

* ChemSpiderID: 34285 (correct: 34285) - CORRECT - Retrieved data from ChemSpider

* PubChem: 37367

* No InChI - (ChemSpider: | InChI=InChI=1/C19H18ClN3O3/c1-22(2)19(25)26-17-18(24)23(3)15-10-9-13(20)11-14(15)16(21-17)12-7-5-4-6-8-12/h4-11,17H,1-3H3 )

* No SMILES - (ChemSpider: | smiles=Clc3cc\1c(N(C(=O)C(OC(=O)N(C)C)/N=C/1c2ccccc2)C)cc3 )
Camostat (2483)
```
Botcommand: addindex 285592138 Camostat
```
```
For index : Camostat=285592138
```
* 59721-29-8 -> 59721-29-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Camostat not found on commonchemistry - Camostat

* No ChemSpiderID

* PubChem: 2536

* No InChI

* No SMILES
Campesterol (2484)
```
Botcommand: addindex 362343590 Campesterol
```
```
For index : Campesterol=362343590
```
* 474-62-4 -> 474-62-4 - NOT VERIFIED

* CAS found on commonchemistry - 474-62-4 - name in list
All names: (24R)-24-Methylcholest-5-en-3Î²-ol, (24R)-5-Ergosten-3Î²-ol, (24R)-ergost-5-en-3Î²-ol, (24R)-ergosta-5-ene-3Î²-ol, (24R)-Methylcholest-5-en-3Î²-ol, 24(R)-Methylcholesterol, 24Î±-Methyl-5-cholesten-3Î²-ol, 24Î±-Methylcholesterol, Campasterol, Campesterin, Campesterol, Ergost-5-en-3-ol, (3Î²,24R)-, Ergost-5-en-3Î²-ol, (24R)-, NSC 224330, Î”5-24-Isoergosten-3Î²-ol

* Campesterol found on commonchemistry - Campesterol
* 474-62-4 (exact match) Matches CAS (474-62-4) on page
Name in list

All names: (24R)-24-Methylcholest-5-en-3Î²-ol, (24R)-5-Ergosten-3Î²-ol, (24R)-ergost-5-en-3Î²-ol, (24R)-ergosta-5-ene-3Î²-ol, (24R)-Methylcholest-5-en-3Î²-ol, 24(R)-Methylcholesterol, 24Î±-Methyl-5-cholesten-3Î²-ol, 24Î±-Methylcholesterol, Campasterol, Campesterin, [[campesterol]], Ergost-5-en-3-ol, (3Î²,24R)-, Ergost-5-en-3Î²-ol, (24R)-, NSC 224330, Î”5-24-Isoergosten-3Î²-ol

* ChemSpiderID: 151215 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 173183

* InChI: 1/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18-20,22-26,29H,7-8,10-17H2,1-6H3/t19-,20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 - (ChemSpider: | InChI=InChI=1/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18-20,22-26,29H,7-8,10-17H2,1-6H3/t19-,20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 )

* SMILES: O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CC[C@@H](C)C(C)C)C)[C@@]3(C)CC4 - (ChemSpider: | SMILES=O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CC[C@@H](C)C(C)C)C)[C@@]3(C)CC4 )
Camphoric_acid (2487)
File:Camphoric acid.PNG
```
Botcommand: addindex 339163958 Camphoric_acid
```
```
For index : Camphoric_acid=339163958
```
* 560-09-8 -> 560-09-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Camphoric+acid not found on commonchemistry - Camphoric+acid

* ChemSpiderID: 190236 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* InChI: 1/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m0/s1 - (ChemSpider: | InChI=InChI=1/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m0/s1 )

* SMILES: O=C(O)[C@]1(CC[C@@H](C(=O)O)C1(C)C)C - (ChemSpider: | SMILES=O=C(O)[C@]1(CC[C@@H](C(=O)O)C1(C)C)C )
Camylofin (2490)
```
Botcommand: addindex 348541675 Camylofin
```
```
For index : Camylofin=348541675
```
* 54-30-8 -> 54-30-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Camylofin not found on commonchemistry - Camylofin

* No ChemSpiderID

* PubChem: 5902

* No InChI

* No SMILES
Canadine (2491)
```
Botcommand: addindex 360044106 Canadine
```
```
For index : Canadine=360044106
```
* 522-97-4 -> 522-97-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Canadine not found on commonchemistry - Canadine

* ChemSpiderID: 19910 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 21171

* InChI: 1/C20H21NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3/t16-/m0/s1 - (ChemSpider: | InChI=InChI=1/C20H21NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3/t16-/m0/s1 )

* SMILES: O1c2c(OC1)cc3c(c2)CCN5[C@H]3Cc4ccc(OC)c(OC)c4C5 - (ChemSpider: | SMILES=O1c2c(OC1)cc3c(c2)CCN5[C@H]3Cc4ccc(OC)c(OC)c4C5 )
Canagliflozin (2492)
* No CASNo

* Canagliflozin not found on commonchemistry - Canagliflozin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Canakinumab (2493)
```
Botcommand: addindex 355964558 Canakinumab
```
```
For index : Canakinumab=355964558
```
* 914613-48-2 -> 914613-48-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Canakinumab not found on commonchemistry - Canakinumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Canaline (2494)
```
Botcommand: addindex 339164349 Canaline
```
```
For index : Canaline=339164349
```
* 496-93-5 -> 496-93-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Canaline not found on commonchemistry - Canaline

* ChemSpiderID: 390176 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 441443

* InChI: 1/C4H10N2O3/c5-3(4(7)8)1-2-9-6/h3H,1-2,5-6H2,(H,7,8)/t3-/m0/s1 - (ChemSpider: | InChI=InChI=1/C4H10N2O3/c5-3(4(7)8)1-2-9-6/h3H,1-2,5-6H2,(H,7,8)/t3-/m0/s1 )

* SMILES: O=C(O)[C@@H](N)CCON - (ChemSpider: | SMILES=O=C(O)[C@@H](N)CCON )
Candicidin (2496)
```
Botcommand: addindex 339164622 Candicidin
```
```
For index : Candicidin=339164622
```
* 1403-17-4 -> 1403-17-4 - NOT VERIFIED

* CAS found on commonchemistry - 1403-17-4 - name in list
All names: Candeptin, Candicidin, candicidina, candicidine, Candimon, NSC 94219, Vanobid

* Candicidin found on commonchemistry - Candicidin
* 1403-17-4 (exact match) Matches CAS (1403-17-4) on page
Name in list

All names: Candeptin, [[candicidin]], [[candicidina]], [[candicidine]], Candimon, NSC 94219, Vanobid

* No ChemSpiderID

* PubChem: 441142

* No InChI

* No SMILES
Candocuronium_iodide (2497)
* No CASNo

* Candocuronium+iodide not found on commonchemistry - Candocuronium+iodide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cangrelor (2498)

* No CASNo

* Cangrelor not found on commonchemistry - Cangrelor

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Cannabichromene (2499)
```
Botcommand: addindex 355291513 Cannabichromene
```
```
For index : Cannabichromene=355291513
```
* 20675-51-8 -> 20675-51-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Cannabichromene not found on commonchemistry - Cannabichromene

* No ChemSpiderID

* PubChem: 30219

* No InChI

* SMILES: CCCCCC1=CC2=C(C=CC(O2)(C)CCC=C(C)C)C(=C1)O
Cannabicyclol (2500)
```
Botcommand: addindex 355278629 Cannabicyclol
```
```
For index : Cannabicyclol=355278629
```
* 21366-63-2 -> 21366-63-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Cannabicyclol not found on commonchemistry - Cannabicyclol

* No ChemSpiderID (correct: 28407)

* PubChem: 30607

* No InChI

* No SMILES

User:Beetstra/listing10

Contents

Data

2251 to 2300

2301 to 2350

2351 to 2400

2401 to 2450

2451 to 2500